1-(4-Fluorobenzyl)-5-hydroxy-3-(2-methoxyethyl)-4,6-dioxo-2,3,4,6-tetrahydro-1H-pyrido[2,1-f][1,2,4]triazine-7-carboxylic Acid

ID: ALA4535763

PubChem CID: 67471511

Max Phase: Preclinical

Molecular Formula: C18H18FN3O6

Molecular Weight: 391.36

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCN1CN(Cc2ccc(F)cc2)n2cc(C(=O)O)c(=O)c(O)c2C1=O

Standard InChI:  InChI=1S/C18H18FN3O6/c1-28-7-6-20-10-21(8-11-2-4-12(19)5-3-11)22-9-13(18(26)27)15(23)16(24)14(22)17(20)25/h2-5,9,24H,6-8,10H2,1H3,(H,26,27)

Standard InChI Key:  LKDWXKYMZLSQQA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   31.6104   -2.7157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6104   -3.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3199   -3.9456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3199   -2.3030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0293   -2.7157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0258   -3.5370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7320   -3.9505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4461   -3.5430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4496   -2.7217    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7389   -2.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1636   -2.3168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8733   -2.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5831   -2.3243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2928   -2.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7413   -1.4865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8974   -2.3092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3198   -1.4817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8992   -3.9508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1909   -3.5391    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9004   -4.7721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7274   -4.7718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4369   -5.1843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4302   -6.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1389   -6.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8499   -6.0140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8519   -5.1885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1467   -4.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5600   -6.4298    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  2  0
  3  6  1  0
  5  4  2  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 10 15  2  0
  1 16  2  0
  4 17  1  0
  2 18  1  0
 18 19  1  0
 18 20  2  0
  7 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
M  END

Associated Targets(non-human)

PA Polymerase acidic protein (806 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Influenza A virus (11224 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 391.36Molecular Weight (Monoisotopic): 391.1180AlogP: 0.59#Rotatable Bonds: 6
Polar Surface Area: 112.31Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.36CX Basic pKa: CX LogP: 0.13CX LogD: -3.28
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.74Np Likeness Score: -0.58

References

1. Miyagawa M, Akiyama T, Taoda Y, Takaya K, Takahashi-Kageyama C, Tomita K, Yasuo K, Hattori K, Shano S, Yoshida R, Shishido T, Yoshinaga T, Sato A, Kawai M..  (2019)  Synthesis and SAR Study of Carbamoyl Pyridone Bicycle Derivatives as Potent Inhibitors of Influenza Cap-dependent Endonuclease.,  62  (17): [PMID:31386363] [10.1021/acs.jmedchem.9b00861]

Source