The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(5,5'-(cycloheptane-1,3-diyl)bis(1,3,4-thiadiazole-5,2-diyl))bis(2-(pyridin-2-yl)acetamide) ID: ALA4535848
PubChem CID: 90163298
Max Phase: Preclinical
Molecular Formula: C25H26N8O2S2
Molecular Weight: 534.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1ccccn1)Nc1nnc(C2CCCCC(c3nnc(NC(=O)Cc4ccccn4)s3)C2)s1
Standard InChI: InChI=1S/C25H26N8O2S2/c34-20(14-18-9-3-5-11-26-18)28-24-32-30-22(36-24)16-7-1-2-8-17(13-16)23-31-33-25(37-23)29-21(35)15-19-10-4-6-12-27-19/h3-6,9-12,16-17H,1-2,7-8,13-15H2,(H,28,32,34)(H,29,33,35)
Standard InChI Key: LOYIFDAIZDWGCQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
9.9246 -23.6447 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.5875 -23.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3332 -22.3860 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5160 -22.3860 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2616 -23.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2929 -23.5746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0008 -23.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7083 -23.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0013 -22.3492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4162 -23.1672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1212 -23.5803 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8287 -23.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8296 -22.3547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1171 -21.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4126 -22.3557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5140 -23.1344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8533 -23.6124 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.2619 -22.3537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4447 -22.3537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1903 -23.1345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4789 -23.5382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7743 -23.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0636 -23.5276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7804 -22.3071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3589 -23.1137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3692 -22.2961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6654 -21.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9537 -22.2856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9502 -23.1070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6546 -23.5171 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1467 -23.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8842 -23.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6186 -23.6712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9558 -24.4481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7953 -24.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4598 -25.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2780 -25.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 5 2 0
2 3 2 0
1 2 1 0
3 4 1 0
5 1 1 0
2 6 1 0
6 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
19 20 2 0
16 18 2 0
17 16 1 0
18 19 1 0
20 17 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
31 32 1 0
32 33 1 0
31 34 1 0
33 35 1 0
34 36 1 0
35 37 1 0
36 37 1 0
31 16 1 0
33 5 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.67Molecular Weight (Monoisotopic): 534.1620AlogP: 4.37#Rotatable Bonds: 8Polar Surface Area: 135.54Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.63CX Basic pKa: 4.63CX LogP: 3.60CX LogD: 2.52Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.32Np Likeness Score: -1.22
References 1. Zimmermann SC, Duvall B, Tsukamoto T.. (2018) Recent Progress in the Discovery of Allosteric Inhibitors of Kidney-Type Glutaminase., 62 (1): [PMID:29969024 ] [10.1021/acs.jmedchem.8b00327 ]