N-[3-(2-Methylpyridin-4-yl)-1H-pyrazolo[4,3-c]pyridin-6-yl]-3-phenylpropanamide

ID: ALA4535851

PubChem CID: 155547655

Max Phase: Preclinical

Molecular Formula: C21H19N5O

Molecular Weight: 357.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2n[nH]c3cc(NC(=O)CCc4ccccc4)ncc23)ccn1

Standard InChI:  InChI=1S/C21H19N5O/c1-14-11-16(9-10-22-14)21-17-13-23-19(12-18(17)25-26-21)24-20(27)8-7-15-5-3-2-4-6-15/h2-6,9-13H,7-8H2,1H3,(H,25,26)(H,23,24,27)

Standard InChI Key:  AIJHKEJKGWZNFV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    5.7737  -18.3647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4834  -17.9553    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4806  -17.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7719  -16.7274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0657  -17.9558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0623  -17.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2804  -16.8841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8005  -17.5504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2858  -18.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0376  -18.9891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2376  -19.1611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9882  -19.9385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5377  -20.5445    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3399  -20.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5856  -19.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8913  -20.9710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1867  -16.7214    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8960  -17.1273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6021  -16.7160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8990  -17.9445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6083  -18.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6114  -19.1676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9025  -19.5749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9053  -20.3914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6150  -20.7981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3235  -20.3824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3173  -19.5674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  9 10  1  0
 14 16  1  0
  3 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4535851

    ---

Associated Targets(Human)

MAPK1 Tchem MAP kinase ERK2 (25055 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Mapk1 MAP kinase ERK2 (650 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 357.42Molecular Weight (Monoisotopic): 357.1590AlogP: 3.90#Rotatable Bonds: 5
Polar Surface Area: 83.56Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.38CX Basic pKa: 4.87CX LogP: 3.14CX LogD: 3.13
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.57Np Likeness Score: -1.30

References

1. Lim J, Kelley EH, Methot JL, Zhou H, Petrocchi A, Chen H, Hill SE, Hinton MC, Hruza A, Jung JO, Maclean JK, Mansueto M, Naumov GN, Philippar U, Raut S, Spacciapoli P, Sun D, Siliphaivanh P..  (2016)  Discovery of 1-(1H-Pyrazolo[4,3-c]pyridin-6-yl)urea Inhibitors of Extracellular Signal-Regulated Kinase (ERK) for the Treatment of Cancers.,  59  (13): [PMID:27329786] [10.1021/acs.jmedchem.6b00708]

Source