N,N'-(Disulfanediylbis(ethane-2,1-diyl))bis(5-(3-bromo-4-methoxyphenyl)-isoxazole-3-carboxamide)

ID: ALA4535890

PubChem CID: 155547817

Max Phase: Preclinical

Molecular Formula: C26H24Br2N4O6S2

Molecular Weight: 712.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2cc(C(=O)NCCSSCCNC(=O)c3cc(-c4ccc(OC)c(Br)c4)on3)no2)cc1Br

Standard InChI:  InChI=1S/C26H24Br2N4O6S2/c1-35-21-5-3-15(11-17(21)27)23-13-19(31-37-23)25(33)29-7-9-39-40-10-8-30-26(34)20-14-24(38-32-20)16-4-6-22(36-2)18(28)12-16/h3-6,11-14H,7-10H2,1-2H3,(H,29,33)(H,30,34)

Standard InChI Key:  HHZKPCYEOJEFGP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
    6.9587   -5.8391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8455   -5.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1296   -5.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6745   -5.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6745   -4.5989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1380   -6.6424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4138   -5.4021    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3945   -5.8350    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2621   -5.8266    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.5421   -5.4146    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.8262   -5.8266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9780   -5.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6980   -5.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1104   -5.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5995   -5.7391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1532   -5.1259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7410   -4.4101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9329   -4.5809    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2004   -5.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6473   -6.1130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0590   -6.8293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8671   -6.6586    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9768   -5.1531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3617   -5.8801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1846   -5.9076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6208   -5.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2281   -4.4781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4066   -4.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8263   -6.1226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4090   -5.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5858   -5.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1788   -6.1346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6011   -6.8472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4230   -6.8373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3557   -6.1480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4415   -5.2369    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9321   -5.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8789   -4.5385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1975   -7.5656    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   18.5725   -6.6347    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  7  1  0
  4  1  1  0
  5  4  2  0
  6  3  2  0
  7 13  1  0
  8  4  1  0
  9 10  1  0
 10 11  1  0
 11 14  1  0
 12  9  1  0
 13 12  1  0
 14  8  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18  2  2  0
  1 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22  1  2  0
 16 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 20 29  1  0
 32 35  1  0
 26 36  1  0
 35 37  1  0
 36 38  1  0
 33 39  1  0
 25 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4535890

    ---

Associated Targets(Human)

HDAC1 Tclin Histone deacetylase (6747 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PC-3 (62116 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HL-60 (67320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 712.44Molecular Weight (Monoisotopic): 709.9504AlogP: 6.08#Rotatable Bonds: 13
Polar Surface Area: 128.72Molecular Species: NEUTRALHBA: 10HBD: 2
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.44CX Basic pKa: CX LogP: 4.45CX LogD: 4.45
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.12Np Likeness Score: -0.69

References

1. Wen J, Bao Y, Niu Q, Liu J, Yang J, Wang W, Jiang T, Fan Y, Li K, Wang J, Zhao L, Liu D..  (2016)  Synthesis, biological evaluation and molecular modeling studies of psammaplin A and its analogs as potent histone deacetylases inhibitors and cytotoxic agents.,  26  (17): [PMID:27460171] [10.1016/j.bmcl.2015.12.094]

Source