The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(Disulfanediylbis(ethane-2,1-diyl))bis(5-(3-bromo-4-methoxyphenyl)-isoxazole-3-carboxamide) ID: ALA4535890
PubChem CID: 155547817
Max Phase: Preclinical
Molecular Formula: C26H24Br2N4O6S2
Molecular Weight: 712.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc(C(=O)NCCSSCCNC(=O)c3cc(-c4ccc(OC)c(Br)c4)on3)no2)cc1Br
Standard InChI: InChI=1S/C26H24Br2N4O6S2/c1-35-21-5-3-15(11-17(21)27)23-13-19(31-37-23)25(33)29-7-9-39-40-10-8-30-26(34)20-14-24(38-32-20)16-4-6-22(36-2)18(28)12-16/h3-6,11-14H,7-10H2,1-2H3,(H,29,33)(H,30,34)
Standard InChI Key: HHZKPCYEOJEFGP-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
6.9587 -5.8391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8455 -5.4021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1296 -5.8141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6745 -5.4271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6745 -4.5989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1380 -6.6424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4138 -5.4021 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3945 -5.8350 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2621 -5.8266 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.5421 -5.4146 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.8262 -5.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9780 -5.4105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6980 -5.8141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1104 -5.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5995 -5.7391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1532 -5.1259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7410 -4.4101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9329 -4.5809 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2004 -5.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6473 -6.1130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0590 -6.8293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8671 -6.6586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9768 -5.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3617 -5.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1846 -5.9076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6208 -5.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2281 -4.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4066 -4.4541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8263 -6.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4090 -5.4107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5858 -5.4171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1788 -6.1346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6011 -6.8472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4230 -6.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3557 -6.1480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4415 -5.2369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9321 -5.4411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8789 -4.5385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1975 -7.5656 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
18.5725 -6.6347 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 7 1 0
4 1 1 0
5 4 2 0
6 3 2 0
7 13 1 0
8 4 1 0
9 10 1 0
10 11 1 0
11 14 1 0
12 9 1 0
13 12 1 0
14 8 1 0
2 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 2 2 0
1 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 1 2 0
16 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
20 29 1 0
32 35 1 0
26 36 1 0
35 37 1 0
36 38 1 0
33 39 1 0
25 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 712.44Molecular Weight (Monoisotopic): 709.9504AlogP: 6.08#Rotatable Bonds: 13Polar Surface Area: 128.72Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.44CX Basic pKa: ┄CX LogP: 4.45CX LogD: 4.45Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.12Np Likeness Score: -0.69
References 1. Wen J, Bao Y, Niu Q, Liu J, Yang J, Wang W, Jiang T, Fan Y, Li K, Wang J, Zhao L, Liu D.. (2016) Synthesis, biological evaluation and molecular modeling studies of psammaplin A and its analogs as potent histone deacetylases inhibitors and cytotoxic agents., 26 (17): [PMID:27460171 ] [10.1016/j.bmcl.2015.12.094 ]