Methyl 4-((3-(2,6-dichlorophenyl)-5-isopropylisoxazol-4-yl)methoxy)benzoate

ID: ALA4535914

PubChem CID: 155548009

Max Phase: Preclinical

Molecular Formula: C21H19Cl2NO4

Molecular Weight: 420.29

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccc(OCc2c(-c3c(Cl)cccc3Cl)noc2C(C)C)cc1

Standard InChI:  InChI=1S/C21H19Cl2NO4/c1-12(2)20-15(11-27-14-9-7-13(8-10-14)21(25)26-3)19(24-28-20)18-16(22)5-4-6-17(18)23/h4-10,12H,11H2,1-3H3

Standard InChI Key:  HNYCWNGXVBOEGR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   40.6064   -5.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6052   -6.7751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3133   -7.1841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0229   -6.7746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0201   -5.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3115   -5.5467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7263   -5.5407    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   39.8986   -5.5471    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   41.3091   -4.7295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9629   -4.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7080   -3.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8908   -3.4723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.6407   -4.2502    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.1864   -2.8073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9994   -2.8903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8518   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7415   -4.4945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3457   -3.9443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.1243   -4.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2954   -4.9892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0731   -5.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6783   -4.6871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5005   -3.8851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7230   -3.6406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.4572   -4.9342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.6327   -5.7324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   47.0607   -4.3833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   47.8397   -4.6304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  1  8  1  0
  6  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13  9  2  0
 11 14  1  0
 14 15  1  0
 14 16  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4535914

    ---

Associated Targets(Human)

NR1H4 Tclin Bile acid receptor FXR (6228 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GPBAR1 Tchem G-protein coupled bile acid receptor 1 (1723 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 420.29Molecular Weight (Monoisotopic): 419.0691AlogP: 6.14#Rotatable Bonds: 6
Polar Surface Area: 61.56Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.24CX LogD: 6.24
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.45Np Likeness Score: -0.91

References

1. Sepe V, Marchianò S, Finamore C, Baronissi G, Di Leva FS, Carino A, Biagioli M, Fiorucci C, Cassiano C, Monti MC, Del Gaudio F, Novellino E, Limongelli V, Fiorucci S, Zampella A..  (2019)  Novel Isoxazole Derivatives with Potent FXR Agonistic Activity Prevent Acetaminophen-Induced Liver Injury.,  10  (4): [PMID:30996771] [10.1021/acsmedchemlett.8b00423]

Source