The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(1-(1-(4-Chloro-3-(trifluoromethyl)benzoyl)piperidin-4-yl)-1H-imidazol-5-yl)phenyl 3-(Cyclopropylcarbamoyl)benzenesulfonate ID: ALA4536033
PubChem CID: 142737944
Max Phase: Preclinical
Molecular Formula: C32H28ClF3N4O5S
Molecular Weight: 673.11
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC1CC1)c1cccc(S(=O)(=O)Oc2ccc(-c3cncn3C3CCN(C(=O)c4ccc(Cl)c(C(F)(F)F)c4)CC3)cc2)c1
Standard InChI: InChI=1S/C32H28ClF3N4O5S/c33-28-11-6-22(17-27(28)32(34,35)36)31(42)39-14-12-24(13-15-39)40-19-37-18-29(40)20-4-9-25(10-5-20)45-46(43,44)26-3-1-2-21(16-26)30(41)38-23-7-8-23/h1-6,9-11,16-19,23-24H,7-8,12-15H2,(H,38,41)
Standard InChI Key: MEJJYQDFKMOLIY-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 51 0 0 0 0 0 0 0 0999 V2000
8.7134 -7.6627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1287 -6.9525 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.3061 -6.9479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3343 -4.9260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3696 -5.7504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0992 -6.1341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7935 -5.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7641 -4.8691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0345 -4.4854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7564 -7.5018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5370 -7.2327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6996 -6.4256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4803 -6.1565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1024 -6.7028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9398 -7.5098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1592 -7.7789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8831 -6.4337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1264 -5.6461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9486 -5.6366 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2177 -6.4172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5568 -6.9106 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5663 -7.7369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2888 -8.1367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2983 -8.9631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5897 -9.3856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8714 -8.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8577 -8.1594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6034 -10.2119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8947 -10.6344 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3217 -10.6116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0344 -10.1892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7527 -10.5931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7623 -11.4195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4846 -11.8193 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.0578 -11.8419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3353 -11.4380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0728 -12.6652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0841 -13.4134 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.4149 -13.2183 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.7471 -13.1980 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.6074 -4.5450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5738 -3.7233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9126 -4.9849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1842 -4.6031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7433 -3.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3615 -4.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
4 9 1 0
6 2 1 0
2 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
11 16 1 0
14 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
17 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
22 27 1 0
25 28 1 0
28 29 2 0
28 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
33 35 1 0
35 36 2 0
30 36 1 0
37 38 1 0
37 39 1 0
37 40 1 0
35 37 1 0
4 41 1 0
41 42 2 0
41 43 1 0
43 44 1 0
45 44 1 0
46 45 1 0
44 46 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 673.11Molecular Weight (Monoisotopic): 672.1421AlogP: 6.36#Rotatable Bonds: 8Polar Surface Area: 110.60Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.98CX Basic pKa: 6.44CX LogP: 4.99CX LogD: 4.96Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.22Np Likeness Score: -1.48
References 1. Park JH, Williams DR, Lee JH, Lee SD, Lee JH, Ko H, Lee GE, Kim S, Lee JM, Abdelrahman A, Müller CE, Jung DW, Kim YC.. (2016) Potent Suppressive Effects of 1-Piperidinylimidazole Based Novel P2X7 Receptor Antagonists on Cancer Cell Migration and Invasion., 59 (16): [PMID:27427902 ] [10.1021/acs.jmedchem.5b01690 ]