The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4536051
PubChem CID: 142411831
Max Phase: Preclinical
Molecular Formula: C23H23N7O2
Molecular Weight: 429.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ncn(-c2ccc3c(c2)C(=O)Nc2cccc(n2)-c2nncn2CCCCO3)c1C
Standard InChI: InChI=1S/C23H23N7O2/c1-15-16(2)30(13-24-15)17-8-9-20-18(12-17)23(31)27-21-7-5-6-19(26-21)22-28-25-14-29(22)10-3-4-11-32-20/h5-9,12-14H,3-4,10-11H2,1-2H3,(H,26,27,31)
Standard InChI Key: VUDQEVYDOQKSDX-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
28.4311 -10.5698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4299 -11.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1380 -11.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8476 -11.3889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8448 -10.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1362 -10.1609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5510 -10.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2602 -10.5609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5479 -9.3378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9664 -10.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6740 -10.5589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3797 -10.1483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3771 -9.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6629 -8.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9601 -9.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0888 -10.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1780 -11.3647 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.9779 -11.5320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3842 -10.8229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8353 -10.2175 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5560 -11.7963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.2630 -11.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9714 -11.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6785 -11.3844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3868 -11.7919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7233 -10.1614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6376 -9.3495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8382 -9.1797 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.4297 -9.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9768 -10.4947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8074 -11.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6171 -9.9733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
12 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 2 0
4 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 17 1 0
1 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 26 1 0
30 31 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.48Molecular Weight (Monoisotopic): 429.1913AlogP: 3.57#Rotatable Bonds: 1Polar Surface Area: 99.75Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.44CX LogP: 2.34CX LogD: 2.30Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -1.03