((6S,7aR)-6-Allyl-7a-((S)-1-(4-methoxyphenyl)propan-2-yl)-7,7adihydrobenzo[d][1,3]dioxol-5(6H)-one)

ID: ALA4536068

PubChem CID: 126509603

Max Phase: Preclinical

Molecular Formula: C20H24O4

Molecular Weight: 328.41

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC[C@H]1C[C@]2([C@@H](C)Cc3ccc(OC)cc3)OCOC2=CC1=O

Standard InChI:  InChI=1S/C20H24O4/c1-4-5-16-12-20(19(11-18(16)21)23-13-24-20)14(2)10-15-6-8-17(22-3)9-7-15/h4,6-9,11,14,16H,1,5,10,12-13H2,2-3H3/t14-,16-,20+/m0/s1

Standard InChI Key:  SJURKDMRNWZHKL-DKICVRJWSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   23.0277   -4.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0277   -5.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7388   -5.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4457   -5.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7388   -3.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4445   -4.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0516   -3.6781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7220   -2.9341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9078   -3.0167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.7388   -6.2771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3179   -5.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6064   -5.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8966   -5.4658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0193   -3.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0191   -2.5867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3109   -3.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5981   -3.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5982   -2.5940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8866   -2.1817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1767   -2.5977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1809   -3.4220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8934   -3.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4693   -2.1907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4633   -1.3686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  5  1  0
  2  3  1  0
  3  4  1  0
  4  6  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  5  9  1  6
  3 10  2  0
  2 11  1  1
 11 12  1  0
 12 13  2  0
  5 14  1  0
 14 15  1  6
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20 23  1  0
 23 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4536068

    ---

Associated Targets(Human)

M14 (47487 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H460 (60772 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 328.41Molecular Weight (Monoisotopic): 328.1675AlogP: 3.67#Rotatable Bonds: 6
Polar Surface Area: 44.76Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.00CX LogD: 4.00
Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.75Np Likeness Score: 1.35

References

1. Huang Z, Williams RB, Martin SM, Lawrence JA, Norman VL, O'Neil-Johnson M, Harding J, Mangette JE, Liu S, Guzzo PR, Starks CM, Eldridge GR..  (2018)  Bifidenone: Structure-Activity Relationship and Advanced Preclinical Candidate.,  61  (15): [PMID:29995409] [10.1021/acs.jmedchem.7b01644]

Source