N-(2-aminoethyl)-2-(4-(2-aminophenylcarbamoyl)benzyl)-4-methylene-1-oxo-1,2,3,4-tetrahydroisoquinoline-6-carboxamide

ID: ALA4536199

PubChem CID: 71502605

Max Phase: Preclinical

Molecular Formula: C27H27N5O3

Molecular Weight: 469.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1CN(Cc2ccc(C(=O)Nc3ccccc3N)cc2)C(=O)c2ccc(C(=O)NCCN)cc21

Standard InChI:  InChI=1S/C27H27N5O3/c1-17-15-32(27(35)21-11-10-20(14-22(17)21)25(33)30-13-12-28)16-18-6-8-19(9-7-18)26(34)31-24-5-3-2-4-23(24)29/h2-11,14H,1,12-13,15-16,28-29H2,(H,30,33)(H,31,34)

Standard InChI Key:  HTSSJURKBUYCAX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   30.7144  -10.2727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4196   -9.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4196   -9.0510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7144   -8.6383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0091   -9.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0116   -9.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3079   -8.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6011   -9.0509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6025   -9.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3068  -10.2738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7144  -11.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1285   -8.6445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8350   -9.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8311   -9.8734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5368  -10.2840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2466   -9.8774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2464   -9.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5401   -8.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9537  -10.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9524  -11.1043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6620   -9.8797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.3691  -10.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3651  -11.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0713  -11.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7806  -11.1096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7793  -10.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0725   -9.8822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0711   -9.0650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7129   -7.8211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.8956  -10.2794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1871   -9.8722    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.8973  -11.0966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4802  -10.2823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7717   -9.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0648  -10.2852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  1 11  2  0
  3 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 16 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 27 28  1  0
  4 29  2  0
  9 30  1  0
 30 31  1  0
 30 32  2  0
 31 33  1  0
 33 34  1  0
 34 35  1  0
M  END

Associated Targets(Human)

HDAC3 Tclin Histone deacetylase 3 (3654 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.55Molecular Weight (Monoisotopic): 469.2114AlogP: 2.88#Rotatable Bonds: 7
Polar Surface Area: 130.55Molecular Species: BASEHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.16CX LogP: 1.81CX LogD: 0.06
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: -0.81

References

1. Sangwan R, Rajan R, Mandal PK..  (2018)  HDAC as onco target: Reviewing the synthetic approaches with SAR study of their inhibitors.,  158  [PMID:30245394] [10.1016/j.ejmech.2018.08.073]

Source