8-Benzyl-2,3,10,11-tetramethoxy-5,6,7,9,14,14a-hexahydro-benzo[3,4]azepino[1,2-b]isoquinolinium bromide

ID: ALA4536287

PubChem CID: 155548492

Max Phase: Preclinical

Molecular Formula: C29H34BrNO4

Molecular Weight: 460.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1OC)C1Cc3ccc(OC)c(OC)c3C[N+]1(Cc1ccccc1)CCC2.[Br-]

Standard InChI:  InChI=1S/C29H34NO4.BrH/c1-31-26-13-12-22-15-25-23-17-28(33-3)27(32-2)16-21(23)11-8-14-30(25,19-24(22)29(26)34-4)18-20-9-6-5-7-10-20;/h5-7,9-10,12-13,16-17,25H,8,11,14-15,18-19H2,1-4H3;1H/q+1;/p-1

Standard InChI Key:  SKNIHMHSYFWQNU-UHFFFAOYSA-M

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   10.8835  -10.4213    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   12.4628   -6.2486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4617   -7.0681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8765   -6.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1679   -5.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8794   -7.0676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1689   -7.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1674   -8.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5848   -7.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8737   -8.6988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5868   -8.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7495   -9.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3119  -10.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1359  -10.0589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3560   -8.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6027   -9.3795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4054   -9.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9623   -8.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7109   -8.1623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9088   -7.9878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2608   -7.5578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7604   -9.1263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0072   -9.9053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0593   -7.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7550   -5.8402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7548   -5.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7540   -7.4768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0463   -7.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1617   -9.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1576   -9.9177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4455  -10.3209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4411  -11.1373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1472  -11.5503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8594  -11.1409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8604  -10.3258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  7  1  0
  6  4  1  0
  4  5  2  0
  5  2  1  0
  6  7  2  0
  7  8  1  0
  8 10  1  0
 11  9  1  0
  9  6  1  0
 10 11  1  0
 11 15  1  0
 10 12  1  0
 12 13  1  0
 16 14  1  0
 13 14  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 18 22  1  0
 22 23  1  0
 21 24  1  0
  2 25  1  0
 25 26  1  0
  3 27  1  0
 27 28  1  0
 10 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
M  CHG  2   1  -1  10   1
M  END

Associated Targets(Human)

EP300 Tchem Histone acetyltransferase p300 (1259 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.59Molecular Weight (Monoisotopic): 460.2482AlogP: 5.48#Rotatable Bonds: 6
Polar Surface Area: 36.92Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 1.15CX LogD: 1.15
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: 0.76

References

1. Huang M, Huang J, Zheng Y, Sun Q..  (2019)  Histone acetyltransferase inhibitors: An overview in synthesis, structure-activity relationship and molecular mechanism.,  178  [PMID:31195169] [10.1016/j.ejmech.2019.05.078]

Source