2-(3-(2-cyanovinyl)phenoxy)-4-(4-(methylthio)pyrimidin-2-ylamino)benzonitrile

ID: ALA4536318

PubChem CID: 56599459

Max Phase: Preclinical

Molecular Formula: C21H15N5OS

Molecular Weight: 385.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CSc1ccnc(Nc2ccc(C#N)c(Oc3cccc(/C=C/C#N)c3)c2)n1

Standard InChI:  InChI=1S/C21H15N5OS/c1-28-20-9-11-24-21(26-20)25-17-8-7-16(14-23)19(13-17)27-18-6-2-4-15(12-18)5-3-10-22/h2-9,11-13H,1H3,(H,24,25,26)/b5-3+

Standard InChI Key:  SSQAOFHSLQYKTC-HWKANZROSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   14.5223  -10.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5212  -10.9312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2292  -11.3402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9389  -10.9307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9360  -10.1081    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2274   -9.7028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2265   -8.8913    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.5175   -8.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6472  -11.3382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3543  -10.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0593  -11.3364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7659  -10.9274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7650  -10.1093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0517   -9.7020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3481  -10.1134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0476   -8.8849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7532   -8.4727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4599   -8.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1650   -8.4664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1613   -7.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4465   -7.2436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7443   -7.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4662   -9.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1727   -9.2863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4395   -6.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1436   -6.0117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1366   -5.1946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1268   -4.3818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  6  7  1  0
  4  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 23 24  3  0
 13 23  1  0
 21 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  3  0
M  END

Associated Targets(Human)

MT2 (2907 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 385.45Molecular Weight (Monoisotopic): 385.0997AlogP: 5.14#Rotatable Bonds: 6
Polar Surface Area: 94.62Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.76CX Basic pKa: 2.01CX LogP: 5.13CX LogD: 5.13
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.36Np Likeness Score: -1.18

References

1. Jorgensen WL..  (2016)  Computer-aided discovery of anti-HIV agents.,  24  (20): [PMID:27485603] [10.1016/j.bmc.2016.07.039]

Source