The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(2-cyanovinyl)phenoxy)-4-(4-(methylthio)pyrimidin-2-ylamino)benzonitrile ID: ALA4536318
PubChem CID: 56599459
Max Phase: Preclinical
Molecular Formula: C21H15N5OS
Molecular Weight: 385.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CSc1ccnc(Nc2ccc(C#N)c(Oc3cccc(/C=C/C#N)c3)c2)n1
Standard InChI: InChI=1S/C21H15N5OS/c1-28-20-9-11-24-21(26-20)25-17-8-7-16(14-23)19(13-17)27-18-6-2-4-15(12-18)5-3-10-22/h2-9,11-13H,1H3,(H,24,25,26)/b5-3+
Standard InChI Key: SSQAOFHSLQYKTC-HWKANZROSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
14.5223 -10.1117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5212 -10.9312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2292 -11.3402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9389 -10.9307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9360 -10.1081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2274 -9.7028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2265 -8.8913 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.5175 -8.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6472 -11.3382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3543 -10.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0593 -11.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7659 -10.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7650 -10.1093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0517 -9.7020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3481 -10.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0476 -8.8849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7532 -8.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4599 -8.8780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1650 -8.4664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1613 -7.6484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4465 -7.2436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7443 -7.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4662 -9.6969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1727 -9.2863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4395 -6.4264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1436 -6.0117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1366 -5.1946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1268 -4.3818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
6 7 1 0
4 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
23 24 3 0
13 23 1 0
21 25 1 0
25 26 2 0
26 27 1 0
27 28 3 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 385.45Molecular Weight (Monoisotopic): 385.0997AlogP: 5.14#Rotatable Bonds: 6Polar Surface Area: 94.62Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.76CX Basic pKa: 2.01CX LogP: 5.13CX LogD: 5.13Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.36Np Likeness Score: -1.18