2-(3-(4-Chlorophenyl)-9H-carbazol-9-yl)-N-(3-methoxybenzyl)-N-methylacetamide

ID: ALA4536533

PubChem CID: 155548339

Max Phase: Preclinical

Molecular Formula: C29H25ClN2O2

Molecular Weight: 468.98

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(CN(C)C(=O)Cn2c3ccccc3c3cc(-c4ccc(Cl)cc4)ccc32)c1

Standard InChI:  InChI=1S/C29H25ClN2O2/c1-31(18-20-6-5-7-24(16-20)34-2)29(33)19-32-27-9-4-3-8-25(27)26-17-22(12-15-28(26)32)21-10-13-23(30)14-11-21/h3-17H,18-19H2,1-2H3

Standard InChI Key:  ASDBAVZYYIJBNG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   29.9636  -13.3846    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5551  -14.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3052  -13.8677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5102  -13.6976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9641  -14.3022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2186  -15.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0131  -15.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6266  -13.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3704  -14.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9123  -15.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7104  -15.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9638  -14.3034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4203  -13.6998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9619  -12.5674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6687  -12.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6670  -11.3401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3773  -12.5644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.3738  -10.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9584  -10.9330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0824  -11.3371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0799  -12.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7877  -12.5586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4955  -12.1485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4911  -11.3271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7828  -10.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1965  -10.9145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9065  -11.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2539  -15.6868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9979  -16.4640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5424  -17.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3431  -16.9046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5963  -16.1232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0501  -15.5182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8892  -17.5125    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  9  1  0
  8  1  1  0
  1  3  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  1 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 16 19  1  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 24 26  1  0
 26 27  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 11 28  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4536533

    ---

Associated Targets(Human)

TSPO Tchem Translocator protein (484 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.98Molecular Weight (Monoisotopic): 468.1605AlogP: 6.78#Rotatable Bonds: 6
Polar Surface Area: 34.47Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.25CX LogD: 6.25
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.27Np Likeness Score: -1.30

References

1. Cheng HWA, Sokias R, Werry EL, Ittner LM, Reekie TA, Du J, Gao Q, Hibbs DE, Kassiou M..  (2019)  First Nondiscriminating Translocator Protein Ligands Produced from a Carbazole Scaffold.,  62  (17): [PMID:31419132] [10.1021/acs.jmedchem.9b00980]

Source