The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(4-Chlorophenyl)-9H-carbazol-9-yl)-N-(3-methoxybenzyl)-N-methylacetamide ID: ALA4536533
PubChem CID: 155548339
Max Phase: Preclinical
Molecular Formula: C29H25ClN2O2
Molecular Weight: 468.98
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(CN(C)C(=O)Cn2c3ccccc3c3cc(-c4ccc(Cl)cc4)ccc32)c1
Standard InChI: InChI=1S/C29H25ClN2O2/c1-31(18-20-6-5-7-24(16-20)34-2)29(33)19-32-27-9-4-3-8-25(27)26-17-22(12-15-28(26)32)21-10-13-23(30)14-11-21/h3-17H,18-19H2,1-2H3
Standard InChI Key: ASDBAVZYYIJBNG-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
29.9636 -13.3846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5551 -14.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3052 -13.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5102 -13.6976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9641 -14.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2186 -15.0796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0131 -15.2461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6266 -13.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3704 -14.6409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9123 -15.2478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7104 -15.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9638 -14.3034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4203 -13.6998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9619 -12.5674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6687 -12.1573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6670 -11.3401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3773 -12.5644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3738 -10.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9584 -10.9330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0824 -11.3371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0799 -12.1516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7877 -12.5586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4955 -12.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4911 -11.3271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7828 -10.9238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1965 -10.9145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9065 -11.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2539 -15.6868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9979 -16.4640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5424 -17.0723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3431 -16.9046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5963 -16.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0501 -15.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8892 -17.5125 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 9 1 0
8 1 1 0
1 3 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
1 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
16 19 1 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
24 26 1 0
26 27 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
11 28 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.98Molecular Weight (Monoisotopic): 468.1605AlogP: 6.78#Rotatable Bonds: 6Polar Surface Area: 34.47Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.25CX LogD: 6.25Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.27Np Likeness Score: -1.30
References 1. Cheng HWA, Sokias R, Werry EL, Ittner LM, Reekie TA, Du J, Gao Q, Hibbs DE, Kassiou M.. (2019) First Nondiscriminating Translocator Protein Ligands Produced from a Carbazole Scaffold., 62 (17): [PMID:31419132 ] [10.1021/acs.jmedchem.9b00980 ]