2-Amino-4-(4-pentafluorothiophenyl)-4H-benzo[h]chromene-3-carbonitrile

ID: ALA4536562

PubChem CID: 155548499

Max Phase: Preclinical

Molecular Formula: C20H13F5N2OS

Molecular Weight: 424.39

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#CC1=C(N)Oc2c(ccc3ccccc23)C1c1ccc(S(F)(F)(F)(F)F)cc1

Standard InChI:  InChI=1S/C20H13F5N2OS/c21-29(22,23,24,25)14-8-5-13(6-9-14)18-16-10-7-12-3-1-2-4-15(12)19(16)28-20(27)17(18)11-26/h1-10,18H,27H2

Standard InChI Key:  CISUNEDRLUOYCJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   22.8251  -18.7028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5332  -19.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8263  -17.8832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5303  -17.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5283  -16.6639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8230  -16.2588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1182  -16.6715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1237  -17.4819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2400  -17.8796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2389  -18.7003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9451  -19.1093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6569  -18.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6581  -17.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9474  -17.4681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3668  -17.4748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3628  -19.1077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0694  -19.5182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.9414  -19.9235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2309  -20.3295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2283  -21.1459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9354  -21.5573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6466  -21.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6457  -20.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9342  -22.3745    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   24.2259  -22.7821    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.6413  -22.7841    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.9285  -23.1909    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.6383  -21.9610    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.2227  -21.9651    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  2  0
  1  2  1  0
  2 10  2  0
  9  4  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 13 15  1  0
 16 17  3  0
 12 16  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 11 18  1  0
 21 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
 24 28  1  0
 24 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4536562

    ---

Associated Targets(Human)

518A2 (464 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HT-29 (80576 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A2780 (11979 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MYB Tbio Transcriptional activator Myb (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.39Molecular Weight (Monoisotopic): 424.0669AlogP: 6.72#Rotatable Bonds: 2
Polar Surface Area: 59.04Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.68CX LogP: 5.97CX LogD: 5.97
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.46Np Likeness Score: -0.71

References

1. Schmitt F, Gold M, Rothemund M, Andronache I, Biersack B, Schobert R, Mueller T..  (2019)  New naphthopyran analogues of LY290181 as potential tumor vascular-disrupting agents.,  163  [PMID:30503940] [10.1016/j.ejmech.2018.11.055]
2. Köhler LHF, Reich S, Yusenko M, Klempnauer KH, Shaikh AH, Ahmed K, Begemann G, Schobert R, Biersack B..  (2022)  A New Naphthopyran Derivative Combines c-Myb Inhibition, Microtubule-Targeting Effects, and Antiangiogenic Properties.,  13  (11.0): [PMID:36385941] [10.1021/acsmedchemlett.2c00403]

Source