The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Isopropyl ((S)-(((2R,3R,4R,5R)-5-(4-methoxy-2-oxopyrimidin-1(2H)-yl)-4-fluoro-3-hydroxy-4-methyltetrahydrofuran-2-yl)methoxy)(phenoxy)phosphoryl)-L-alaninate ID: ALA4536594
PubChem CID: 155548751
Max Phase: Preclinical
Molecular Formula: C23H31FN3O9P
Molecular Weight: 543.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccn([C@@H]2O[C@H](CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc3ccccc3)[C@@H](O)[C@@]2(C)F)c(=O)n1
Standard InChI: InChI=1S/C23H31FN3O9P/c1-14(2)34-20(29)15(3)26-37(31,36-16-9-7-6-8-10-16)33-13-17-19(28)23(4,24)21(35-17)27-12-11-18(32-5)25-22(27)30/h6-12,14-15,17,19,21,28H,13H2,1-5H3,(H,26,31)/t15-,17+,19+,21+,23+,37-/m0/s1
Standard InChI Key: TXHFSJCQLSGTRF-HEFSGLBYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
5.4645 -3.8094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4635 -4.6266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7555 -5.0302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7543 -5.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4621 -6.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1726 -5.8447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1704 -5.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4645 -2.3938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8772 -3.1037 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
6.2856 -2.3913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0043 -3.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7733 -4.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0675 -4.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0665 -5.1078 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.3260 -3.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2544 -4.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6630 -3.0335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0331 -3.1060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0331 -2.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7384 -3.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4437 -3.1060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4437 -2.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7384 -1.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7384 -4.3277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1526 -1.8823 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8591 -2.2930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7732 -4.9529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5889 -3.5156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2966 -3.1070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6473 -2.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2408 -3.1052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4236 -3.1077 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6515 -3.8117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2365 -1.6898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0172 -3.8166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2000 -3.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4279 -4.5231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
9 8 1 0
10 9 2 0
16 13 1 0
13 15 1 0
15 17 1 0
17 11 1 0
11 16 1 0
15 18 1 1
19 18 1 0
19 23 2 0
18 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
20 24 2 0
22 25 1 0
25 26 1 0
13 12 1 1
13 14 1 0
16 27 1 6
28 29 1 0
11 29 1 1
28 9 1 0
8 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
9 1 1 1
30 34 1 6
32 35 1 0
35 36 1 0
35 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 543.49Molecular Weight (Monoisotopic): 543.1782AlogP: 2.37#Rotatable Bonds: 11Polar Surface Area: 147.44Molecular Species: NEUTRALHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.24CX Basic pKa: ┄CX LogP: 1.76CX LogD: 1.76Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.32Np Likeness Score: 0.14
References 1. Guo S, Xu M, Guo Q, Zhu F, Jiang X, Xie Y, Shen J.. (2019) Discovery of pyrimidine nucleoside dual prodrugs and pyrazine nucleosides as novel anti-HCV agents., 27 (5): [PMID:30683552 ] [10.1016/j.bmc.2019.01.007 ]