N-[4-(Diethylamino)phenyl]-3-[4'-fluoro-[1,1'-biphenyl]-4-yl]-5-methylisoxazole-4-carboxamide

ID: ALA4536598

PubChem CID: 155548754

Max Phase: Preclinical

Molecular Formula: C27H26FN3O2

Molecular Weight: 443.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)c1ccc(NC(=O)c2c(-c3ccc(-c4ccc(F)cc4)cc3)noc2C)cc1

Standard InChI:  InChI=1S/C27H26FN3O2/c1-4-31(5-2)24-16-14-23(15-17-24)29-27(32)25-18(3)33-30-26(25)21-8-6-19(7-9-21)20-10-12-22(28)13-11-20/h6-17H,4-5H2,1-3H3,(H,29,32)

Standard InChI Key:  AOHVEAGZJBPTLW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    2.9098   -5.2771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9036   -6.0984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6825   -6.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1738   -5.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6925   -5.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9272   -7.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9909   -5.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4048   -5.0007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3942   -6.4161    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2114   -6.4222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6128   -7.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4292   -7.1414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8439   -6.4362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4362   -5.7231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6211   -5.7202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6611   -6.4412    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0653   -7.1514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0740   -5.7360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8912   -5.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8825   -7.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9488   -4.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7507   -4.0972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0089   -3.3226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4663   -2.7105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6621   -2.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4076   -3.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7208   -1.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5225   -1.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7797   -0.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2363   -0.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4323   -0.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1789   -1.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4923    0.3881    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  3  6  1  0
  4  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 13 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 17 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
  5 21  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 24 27  1  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4536598

    ---

Associated Targets(non-human)

Gata4 GATA4/NKX2-5 (206 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Nkx2-5 Homeobox protein Nkx-2.5 (120 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Gata4 Transcription factor GATA-4 (136 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.52Molecular Weight (Monoisotopic): 443.2009AlogP: 6.55#Rotatable Bonds: 7
Polar Surface Area: 58.37Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.89CX Basic pKa: 5.42CX LogP: 6.27CX LogD: 6.27
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.35Np Likeness Score: -1.65

References

1. Jumppanen M, Kinnunen SM, Välimäki MJ, Talman V, Auno S, Bruun T, Boije Af Gennäs G, Xhaard H, Aumüller IB, Ruskoaho H, Yli-Kauhaluoma J..  (2019)  Synthesis, Identification, and Structure-Activity Relationship Analysis of GATA4 and NKX2-5 Protein-Protein Interaction Modulators.,  62  (17): [PMID:31431011] [10.1021/acs.jmedchem.9b01086]

Source