N-(2-Bromo-4-fluorophenyl)-7-((2,4-difluorophenyl)sulfonyl)-5,6,7,8-tetrahydropyrido[4',3':4,5]thieno[2,3-d]pyrimidin-4-amine

ID: ALA4536609

PubChem CID: 155548114

Max Phase: Preclinical

Molecular Formula: C21H14BrF3N4O2S2

Molecular Weight: 555.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=S(=O)(c1ccc(F)cc1F)N1CCc2c(sc3ncnc(Nc4ccc(F)cc4Br)c23)C1

Standard InChI:  InChI=1S/C21H14BrF3N4O2S2/c22-14-7-11(23)1-3-16(14)28-20-19-13-5-6-29(9-17(13)32-21(19)27-10-26-20)33(30,31)18-4-2-12(24)8-15(18)25/h1-4,7-8,10H,5-6,9H2,(H,26,27,28)

Standard InChI Key:  XFNDFVLMQVKOEJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   22.3201  -13.1989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3242  -12.3817    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.6144  -12.7867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9535  -10.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9524  -11.1706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6604  -11.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3701  -11.1701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3672  -10.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6586   -9.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2443  -11.5786    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.2437  -12.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2425  -14.0287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.9529  -13.6163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9504  -12.8012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.5346  -13.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5315  -12.8028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7595  -13.8738    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   24.2773  -13.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7558  -12.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4276  -11.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6198  -11.7312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1415  -12.3882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4705  -13.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9205  -11.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3373  -10.9685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9342  -10.2586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1161  -10.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7029  -10.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1084  -11.6696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1545  -10.9760    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.7114   -9.5427    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.0734   -9.9362    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.2457   -9.9426    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5 10  1  0
 10 11  1  0
 11 16  2  0
 15 12  2  0
 12 13  1  0
 13 14  2  0
 14 11  1  0
 15 16  1  0
 16 19  1  0
 18 17  1  0
 17 15  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22  2  1  0
  2 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 25 30  1  0
 27 31  1  0
  8 32  1  0
  4 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4536609

    ---

Associated Targets(Human)

SUNE1 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MKNK1 Tchem MAP kinase-interacting serine/threonine-protein kinase MNK1 (2071 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
786-0 (47912 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 555.40Molecular Weight (Monoisotopic): 553.9694AlogP: 5.36#Rotatable Bonds: 4
Polar Surface Area: 75.19Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 2.51CX LogP: 5.47CX LogD: 5.47
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -2.39

References

1. Zhang M, Jiang L, Tao J, Pan Z, He M, Su D, He G, Jiang Q..  (2019)  Design, synthesis and biological evaluation of 4-aniline-thieno[2,3-d]pyrimidine derivatives as MNK1 inhibitors against renal cell carcinoma and nasopharyngeal carcinoma.,  27  (11): [PMID:31014565] [10.1016/j.bmc.2019.04.022]

Source