The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(4-Carbamoylphenyl)-3-hydroxy-2-oxopyrrolidine-3-carboxylic Acid 3-Chloro-5-fluorobenzylamide ID: ALA4536649
PubChem CID: 89893272
Max Phase: Preclinical
Molecular Formula: C19H17ClFN3O4
Molecular Weight: 405.81
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1ccc(N2CC[C@](O)(C(=O)NCc3cc(F)cc(Cl)c3)C2=O)cc1
Standard InChI: InChI=1S/C19H17ClFN3O4/c20-13-7-11(8-14(21)9-13)10-23-17(26)19(28)5-6-24(18(19)27)15-3-1-12(2-4-15)16(22)25/h1-4,7-9,28H,5-6,10H2,(H2,22,25)(H,23,26)/t19-/m0/s1
Standard InChI Key: DNBZUYUEKSXSFF-IBGZPJMESA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
15.1894 -4.7159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9893 -4.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7770 -4.1316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7045 -7.4405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7034 -8.2677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4181 -8.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1345 -8.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1316 -7.4369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4163 -7.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4080 -6.2020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0738 -5.7152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8166 -4.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7393 -5.7192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9555 -5.9765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3618 -3.5499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9808 -3.9159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1580 -3.7655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7428 -3.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5385 -3.4018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1231 -2.8209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9119 -2.0225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1110 -1.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5298 -2.3909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9192 -3.0369 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17.8968 -1.0118 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.4179 -9.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7034 -9.9177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1321 -9.9181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 1
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
11 12 1 0
12 2 1 0
2 13 1 0
13 10 1 0
9 10 1 0
13 14 2 0
3 15 1 0
3 16 2 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
20 24 1 0
22 25 1 0
6 26 1 0
26 27 1 0
26 28 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.81Molecular Weight (Monoisotopic): 405.0892AlogP: 1.36#Rotatable Bonds: 5Polar Surface Area: 112.73Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.76CX Basic pKa: ┄CX LogP: 0.96CX LogD: 0.95Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.65Np Likeness Score: -1.22
References 1. Heinrich T, Seenisamy J, Blume B, Bomke J, Calderini M, Eckert U, Friese-Hamim M, Kohl R, Lehmann M, Leuthner B, Musil D, Rohdich F, Zenke FT.. (2019) Discovery and Structure-Based Optimization of Next-Generation Reversible Methionine Aminopeptidase-2 (MetAP-2) Inhibitors., 62 (10): [PMID:30939017 ] [10.1021/acs.jmedchem.9b00041 ]