Microsporol A

ID: ALA4536679

PubChem CID: 155548694

Max Phase: Preclinical

Molecular Formula: C19H27ClO7

Molecular Weight: 402.87

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCC(O)/C=C/C1=C(CO)[C@@H](O)[C@@H](O)[C@](Cl)(C/C=C(\C)C(=O)O)C1=O

Standard InChI:  InChI=1S/C19H27ClO7/c1-3-4-5-12(22)6-7-13-14(10-21)15(23)17(25)19(20,16(13)24)9-8-11(2)18(26)27/h6-8,12,15,17,21-23,25H,3-5,9-10H2,1-2H3,(H,26,27)/b7-6+,11-8+/t12?,15-,17-,19+/m1/s1

Standard InChI Key:  SVHYCWCWJWZMDV-SLSLKQQYSA-N

Molfile:  

 
     RDKit          2D

 27 27  0  0  0  0  0  0  0  0999 V2000
    6.9323  -22.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9323  -22.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6454  -23.3857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3585  -22.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3585  -22.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6454  -21.7346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2156  -21.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5055  -22.1536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7887  -21.7450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0744  -22.1578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7863  -20.9194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3577  -21.7491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6433  -22.1619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9266  -21.7533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6454  -20.9090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2174  -23.3909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5055  -22.9770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6454  -24.2113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0735  -23.3909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0752  -21.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0688  -22.5643    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.7896  -22.1536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5063  -21.7450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2205  -22.1578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5087  -20.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2181  -22.9834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9331  -21.7491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
  6 15  2  0
  2 16  1  0
 16 17  1  0
  3 18  1  6
  4 19  1  6
  5 20  1  0
  5 21  1  6
 20 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 24 26  1  0
 24 27  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4536679

    ---

Associated Targets(Human)

ALOX5 Tclin Arachidonate 5-lipoxygenase (6568 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.87Molecular Weight (Monoisotopic): 402.1445AlogP: 1.09#Rotatable Bonds: 9
Polar Surface Area: 135.29Molecular Species: ACIDHBA: 6HBD: 5
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 4.06CX Basic pKa: CX LogP: 1.33CX LogD: -1.80
Aromatic Rings: Heavy Atoms: 27QED Weighted: 0.29Np Likeness Score: 2.16

References

1. Li SJ, Zhang X, Wang XH, Zhao CQ..  (2018)  Novel natural compounds from endophytic fungi with anticancer activity.,  156  [PMID:30015071] [10.1016/j.ejmech.2018.07.015]

Source