The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Microsporol A ID: ALA4536679
PubChem CID: 155548694
Max Phase: Preclinical
Molecular Formula: C19H27ClO7
Molecular Weight: 402.87
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC(O)/C=C/C1=C(CO)[C@@H](O)[C@@H](O)[C@](Cl)(C/C=C(\C)C(=O)O)C1=O
Standard InChI: InChI=1S/C19H27ClO7/c1-3-4-5-12(22)6-7-13-14(10-21)15(23)17(25)19(20,16(13)24)9-8-11(2)18(26)27/h6-8,12,15,17,21-23,25H,3-5,9-10H2,1-2H3,(H,26,27)/b7-6+,11-8+/t12?,15-,17-,19+/m1/s1
Standard InChI Key: SVHYCWCWJWZMDV-SLSLKQQYSA-N
Molfile:
RDKit 2D
27 27 0 0 0 0 0 0 0 0999 V2000
6.9323 -22.1495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9323 -22.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6454 -23.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3585 -22.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3585 -22.1495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6454 -21.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2156 -21.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5055 -22.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7887 -21.7450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0744 -22.1578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7863 -20.9194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3577 -21.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6433 -22.1619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9266 -21.7533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6454 -20.9090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2174 -23.3909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5055 -22.9770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6454 -24.2113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0735 -23.3909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0752 -21.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0688 -22.5643 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.7896 -22.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5063 -21.7450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2205 -22.1578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5087 -20.9194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2181 -22.9834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9331 -21.7491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
9 11 1 0
10 12 1 0
12 13 1 0
13 14 1 0
6 15 2 0
2 16 1 0
16 17 1 0
3 18 1 6
4 19 1 6
5 20 1 0
5 21 1 6
20 22 1 0
22 23 2 0
23 24 1 0
23 25 1 0
24 26 1 0
24 27 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 402.87Molecular Weight (Monoisotopic): 402.1445AlogP: 1.09#Rotatable Bonds: 9Polar Surface Area: 135.29Molecular Species: ACIDHBA: 6HBD: 5#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.06CX Basic pKa: ┄CX LogP: 1.33CX LogD: -1.80Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.29Np Likeness Score: 2.16