Cis-4-((4,5-Dihydroisoxazol-3-yl)oxy)-N,N-dimethyl-N-(4-(phenyldiazenyl)benzyl)but-2-yn-1-aminium Bromide

ID: ALA4536683

Max Phase: Preclinical

Molecular Formula: C22H25BrN4O2

Molecular Weight: 377.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[N+](C)(CC#CCOC1=NOCC1)Cc1ccc(/N=N\c2ccccc2)cc1.[Br-]

Standard InChI:  InChI=1S/C22H25N4O2.BrH/c1-26(2,15-6-7-16-27-22-14-17-28-25-22)18-19-10-12-21(13-11-19)24-23-20-8-4-3-5-9-20;/h3-5,8-13H,14-18H2,1-2H3;1H/q+1;/p-1/b24-23-;

Standard InChI Key:  IVNFEKIBQWIHFT-DCXSSQDFSA-M

Molfile:  

     RDKit          2D

 29 30  0  0  0  0  0  0  0  0999 V2000
   13.1519  -23.9285    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   11.3311  -24.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0466  -25.0929    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7620  -24.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4775  -25.0929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1915  -25.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9092  -25.9083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6225  -25.4895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6178  -24.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2746  -24.1778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0165  -23.3939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1909  -23.3985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9416  -24.1852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0466  -25.9184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3248  -25.4953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3290  -23.8567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0420  -23.4481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0402  -22.6275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3267  -22.2158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6177  -22.6348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6230  -23.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3234  -21.3903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0372  -20.9767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7543  -21.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7523  -22.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4686  -22.6229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1834  -22.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1774  -21.3753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4606  -20.9714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  3  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  9  1  0
  3 14  1  0
  3 15  1  0
 16  2  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
M  CHG  2   1  -1   3   1
M  END

Associated Targets(Human)

CHRM1 Tclin Muscarinic acetylcholine receptor M1 (12690 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 377.47Molecular Weight (Monoisotopic): 377.1972AlogP: 4.43#Rotatable Bonds: 6
Polar Surface Area: 55.54Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.76CX LogP: 0.68CX LogD: 0.68
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.42Np Likeness Score: -0.34

References

1. Agnetta L, Bermudez M, Riefolo F, Matera C, Claro E, Messerer R, Littmann T, Wolber G, Holzgrabe U, Decker M..  (2019)  Fluorination of Photoswitchable Muscarinic Agonists Tunes Receptor Pharmacology and Photochromic Properties.,  62  (6): [PMID:30827105] [10.1021/acs.jmedchem.8b01822]

Source