The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(sec-Butoxy)-5-chlorobenzyl)-N-(4-(N-(prop-2-yn-1-yl)sulfamoyl)phenethyl)-2-(thiophen-3-yl)acetamide ID: ALA4536818
PubChem CID: 155548119
Max Phase: Preclinical
Molecular Formula: C28H31ClN2O4S2
Molecular Weight: 559.15
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCNS(=O)(=O)c1ccc(CCN(Cc2cc(Cl)ccc2OC(C)CC)C(=O)Cc2ccsc2)cc1
Standard InChI: InChI=1S/C28H31ClN2O4S2/c1-4-14-30-37(33,34)26-9-6-22(7-10-26)12-15-31(28(32)17-23-13-16-36-20-23)19-24-18-25(29)8-11-27(24)35-21(3)5-2/h1,6-11,13,16,18,20-21,30H,5,12,14-15,17,19H2,2-3H3
Standard InChI Key: UNKCWPHIODEYHI-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
37.0006 -26.3358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.5961 -25.6260 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.1830 -26.3332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.8859 -24.4061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1764 -23.9929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4674 -24.4033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4667 -25.2226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1809 -25.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8870 -25.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7559 -23.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0437 -24.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3363 -23.9889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6242 -24.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9126 -23.9878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9168 -23.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2061 -22.7577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4930 -23.1658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4950 -23.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2062 -24.4008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2090 -25.2222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.3107 -25.2177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.3123 -24.3964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0249 -23.9851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7299 -23.5706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2071 -21.9405 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
30.9180 -25.6284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9208 -26.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3380 -23.1717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0465 -22.7646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6311 -22.7617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0482 -21.9474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7107 -21.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4598 -20.6864 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.6425 -20.6847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3886 -21.4614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6244 -25.2174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6298 -26.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
19 20 1 0
9 2 1 0
2 21 1 0
21 22 1 0
22 23 1 0
23 24 3 0
16 25 1 0
20 26 1 0
26 27 1 0
12 28 1 0
28 29 1 0
28 30 2 0
29 31 1 0
31 32 2 0
32 33 1 0
33 34 1 0
34 35 2 0
35 31 1 0
26 36 1 0
27 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 559.15Molecular Weight (Monoisotopic): 558.1414AlogP: 5.30#Rotatable Bonds: 13Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.13CX Basic pKa: ┄CX LogP: 5.57CX LogD: 5.57Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -2.12
References 1. Jiang Y, He L, Green J, Blevins H, Guo C, Patel SH, Halquist MS, McRae M, Venitz J, Wang XY, Zhang S.. (2019) Discovery of Second-Generation NLRP3 Inflammasome Inhibitors: Design, Synthesis, and Biological Characterization., 62 (21): [PMID:31626545 ] [10.1021/acs.jmedchem.9b01155 ]