N-(2-(sec-Butoxy)-5-chlorobenzyl)-N-(4-(N-(prop-2-yn-1-yl)sulfamoyl)phenethyl)-2-(thiophen-3-yl)acetamide

ID: ALA4536818

PubChem CID: 155548119

Max Phase: Preclinical

Molecular Formula: C28H31ClN2O4S2

Molecular Weight: 559.15

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C#CCNS(=O)(=O)c1ccc(CCN(Cc2cc(Cl)ccc2OC(C)CC)C(=O)Cc2ccsc2)cc1

Standard InChI:  InChI=1S/C28H31ClN2O4S2/c1-4-14-30-37(33,34)26-9-6-22(7-10-26)12-15-31(28(32)17-23-13-16-36-20-23)19-24-18-25(29)8-11-27(24)35-21(3)5-2/h1,6-11,13,16,18,20-21,30H,5,12,14-15,17,19H2,2-3H3

Standard InChI Key:  UNKCWPHIODEYHI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   37.0006  -26.3358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5961  -25.6260    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   36.1830  -26.3332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8859  -24.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1764  -23.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4674  -24.4033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4667  -25.2226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1809  -25.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8870  -25.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7559  -23.9900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0437  -24.4022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3363  -23.9889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6242  -24.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9126  -23.9878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9168  -23.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2061  -22.7577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4930  -23.1658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4950  -23.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2062  -24.4008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2090  -25.2222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.3107  -25.2177    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.3123  -24.3964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0249  -23.9851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7299  -23.5706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2071  -21.9405    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   30.9180  -25.6284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9208  -26.4456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3380  -23.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0465  -22.7646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6311  -22.7617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.0482  -21.9474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7107  -21.4641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4598  -20.6864    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   32.6425  -20.6847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3886  -21.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6244  -25.2174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6298  -26.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 19 20  1  0
  9  2  1  0
  2 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  3  0
 16 25  1  0
 20 26  1  0
 26 27  1  0
 12 28  1  0
 28 29  1  0
 28 30  2  0
 29 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 35 31  1  0
 26 36  1  0
 27 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4536818

    ---

Associated Targets(non-human)

Nlrp3 NACHT, LRR and PYD domains-containing protein 3 (641 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 559.15Molecular Weight (Monoisotopic): 558.1414AlogP: 5.30#Rotatable Bonds: 13
Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.13CX Basic pKa: CX LogP: 5.57CX LogD: 5.57
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -2.12

References

1. Jiang Y, He L, Green J, Blevins H, Guo C, Patel SH, Halquist MS, McRae M, Venitz J, Wang XY, Zhang S..  (2019)  Discovery of Second-Generation NLRP3 Inflammasome Inhibitors: Design, Synthesis, and Biological Characterization.,  62  (21): [PMID:31626545] [10.1021/acs.jmedchem.9b01155]

Source