The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3-(4-((3,7-Dimethylocta-2,6-dien-1-yl)oxy)-3-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one ID: ALA4536826
PubChem CID: 155548162
Max Phase: Preclinical
Molecular Formula: C29H36O6
Molecular Weight: 480.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)c2cc(OC)c(OC)c(OC)c2)ccc1OC/C=C(\C)CCC=C(C)C
Standard InChI: InChI=1S/C29H36O6/c1-20(2)9-8-10-21(3)15-16-35-25-14-12-22(17-26(25)31-4)11-13-24(30)23-18-27(32-5)29(34-7)28(19-23)33-6/h9,11-15,17-19H,8,10,16H2,1-7H3/b13-11+,21-15+
Standard InChI Key: VLXPYAWVJCPHJV-DTXJCZLISA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
12.6428 -14.9409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9254 -14.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9057 -13.7326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2278 -14.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1883 -13.3411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1686 -12.5242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4513 -12.1328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4316 -11.3158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7536 -12.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7142 -10.9244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6945 -10.1075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9082 -9.7214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6160 -10.1300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2789 -10.1097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5731 -9.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3251 -8.9024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3240 -9.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0320 -10.1309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 -9.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7389 -8.8988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0302 -8.4935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4450 -8.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1543 -8.8935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4419 -7.6703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8604 -8.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5697 -8.8881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9852 -9.6987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9795 -8.8773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2705 -8.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6173 -8.4940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6171 -7.6768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0318 -10.9481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3240 -11.3565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6842 -8.4636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3949 -8.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
7 9 1 0
8 10 1 0
10 11 1 0
12 13 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
20 22 1 0
22 23 1 0
22 24 2 0
23 25 2 0
25 26 1 0
26 15 2 0
15 14 1 0
14 27 2 0
27 28 1 0
28 29 2 0
29 26 1 0
17 13 1 0
27 11 1 0
16 30 1 0
30 31 1 0
18 32 1 0
32 33 1 0
28 34 1 0
34 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.60Molecular Weight (Monoisotopic): 480.2512AlogP: 6.69#Rotatable Bonds: 13Polar Surface Area: 63.22Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.12CX LogD: 6.12Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.18Np Likeness Score: 0.84
References 1. Espinoza-Hicks JC, Chacón-Vargas KF, Hernández-Rivera JL, Nogueda-Torres B, Tamariz J, Sánchez-Torres LE, Camacho-Dávila A.. (2019) Novel prenyloxy chalcones as potential leishmanicidal and trypanocidal agents: Design, synthesis and evaluation., 167 [PMID:30784876 ] [10.1016/j.ejmech.2019.02.028 ]