The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((2S,3R)-4-(4-amino-N-isobutylphenylsulfonamido)-3-hydroxy-1-phenylbutan-2-yl)-2-(6-methoxy-9H-purin-9-yl)acetamide ID: ALA4536902
PubChem CID: 145999457
Max Phase: Preclinical
Molecular Formula: C28H35N7O5S
Molecular Weight: 581.70
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ncnc2c1ncn2CC(=O)N[C@@H](Cc1ccccc1)[C@H](O)CN(CC(C)C)S(=O)(=O)c1ccc(N)cc1
Standard InChI: InChI=1S/C28H35N7O5S/c1-19(2)14-35(41(38,39)22-11-9-21(29)10-12-22)15-24(36)23(13-20-7-5-4-6-8-20)33-25(37)16-34-18-32-26-27(34)30-17-31-28(26)40-3/h4-12,17-19,23-24,36H,13-16,29H2,1-3H3,(H,33,37)/t23-,24+/m0/s1
Standard InChI Key: VBTRSRHMBAWLHP-BJKOFHAPSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
38.5070 -25.8199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9198 -26.5298 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
39.3282 -25.8175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2592 -26.5340 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9669 -26.9425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6746 -26.5340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3823 -26.9425 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.6746 -25.7168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0900 -26.5340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7977 -26.9425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5054 -26.5340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2131 -26.9425 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6285 -26.9425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6269 -27.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3338 -28.1693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0425 -27.7607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0398 -26.9393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3324 -26.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7977 -27.7597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0900 -25.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7977 -25.3082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5053 -25.7191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2125 -25.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2130 -24.4931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5003 -24.0847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7960 -24.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2152 -27.7597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1695 -25.7239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3701 -25.5540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5084 -26.8689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9649 -26.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1690 -26.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9155 -27.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4640 -27.8106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2579 -27.6400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7918 -28.3334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6090 -28.3334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4801 -29.0888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6235 -25.8204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8777 -25.0438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7507 -28.1683 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 2 1 0
2 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
10 19 1 1
9 20 1 1
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
12 27 1 0
4 28 1 0
28 29 2 0
29 31 1 0
30 4 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
27 36 1 0
36 37 1 0
36 38 1 0
32 39 1 0
39 40 1 0
16 41 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 581.70Molecular Weight (Monoisotopic): 581.2420AlogP: 1.85#Rotatable Bonds: 13Polar Surface Area: 165.56Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.17CX Basic pKa: 2.89CX LogP: 1.97CX LogD: 1.97Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.20Np Likeness Score: -0.85
References 1. Zhu M, Dong B, Zhang GN, Wang JX, Cen S, Wang YC.. (2019) Synthesis and biological evaluation of new HIV-1 protease inhibitors with purine bases as P2-ligands., 29 (12): [PMID:31014912 ] [10.1016/j.bmcl.2019.03.049 ]