The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Alismanol H ID: ALA4536937
PubChem CID: 155548163
Max Phase: Preclinical
Molecular Formula: C29H44O3
Molecular Weight: 440.67
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)/C=C/C[C@@H](C)C1=C2C[C@H](O)[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@]3(C)[C@@]2(C)CC1
Standard InChI: InChI=1S/C29H44O3/c1-18(9-8-10-19(2)30)20-11-15-28(6)21(20)17-22(31)25-27(5)14-13-24(32)26(3,4)23(27)12-16-29(25,28)7/h8,10,18,22-23,25,31H,9,11-17H2,1-7H3/b10-8+/t18-,22+,23+,25+,27+,28+,29+/m1/s1
Standard InChI Key: FVTATMKLLGHXAR-FVINUGJUSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
28.1188 -22.9845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7143 -22.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3012 -22.9819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0086 -21.0489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0086 -21.8702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7180 -20.6361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4233 -21.0489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4198 -21.8702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1260 -22.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8443 -21.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1329 -20.6410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8439 -21.0573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8606 -19.4185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1382 -19.8224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5633 -19.8389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5500 -20.6568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3239 -20.9168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1259 -21.4616 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
28.4160 -20.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8357 -20.2358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4118 -22.6874 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
26.2973 -22.2839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5456 -21.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3455 -19.6003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8158 -20.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4342 -19.4075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6140 -18.8188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4241 -18.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0725 -18.1990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9657 -19.2809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7758 -19.1234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3214 -19.7431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0603 -20.5174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1226 -19.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
4 6 1 0
5 2 1 0
2 8 1 0
7 6 1 0
7 8 1 0
7 11 1 0
8 9 1 0
9 10 1 0
10 12 1 0
11 12 1 0
11 14 1 0
12 16 1 0
15 13 1 0
13 14 1 0
15 16 1 0
16 17 1 0
17 25 1 0
24 15 2 0
11 18 1 1
7 19 1 1
12 20 1 6
8 21 1 6
5 22 2 0
16 23 1 1
24 25 1 0
14 26 1 1
24 27 1 0
27 28 1 0
27 29 1 6
28 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.67Molecular Weight (Monoisotopic): 440.3290AlogP: 6.45#Rotatable Bonds: 4Polar Surface Area: 54.37Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.64CX LogD: 5.64Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: 3.29
References 1. Luan ZL, Huo XK, Dong PP, Tian XG, Sun CP, Lv X, Feng L, Ning J, Wang C, Zhang BJ, Ma XC.. (2019) Highly potent non-steroidal FXR agonists protostane-type triterpenoids: Structure-activity relationship and mechanism., 182 [PMID:31494470 ] [10.1016/j.ejmech.2019.111652 ]