Alismanol H

ID: ALA4536937

PubChem CID: 155548163

Max Phase: Preclinical

Molecular Formula: C29H44O3

Molecular Weight: 440.67

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)/C=C/C[C@@H](C)C1=C2C[C@H](O)[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@]3(C)[C@@]2(C)CC1

Standard InChI:  InChI=1S/C29H44O3/c1-18(9-8-10-19(2)30)20-11-15-28(6)21(20)17-22(31)25-27(5)14-13-24(32)26(3,4)23(27)12-16-29(25,28)7/h8,10,18,22-23,25,31H,9,11-17H2,1-7H3/b10-8+/t18-,22+,23+,25+,27+,28+,29+/m1/s1

Standard InChI Key:  FVTATMKLLGHXAR-FVINUGJUSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   28.1188  -22.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7143  -22.2788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3012  -22.9819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0086  -21.0489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0086  -21.8702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7180  -20.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4233  -21.0489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4198  -21.8702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1260  -22.2836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8443  -21.8762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1329  -20.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8439  -21.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8606  -19.4185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1382  -19.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5633  -19.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5500  -20.6568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3239  -20.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1259  -21.4616    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.4160  -20.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8357  -20.2358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4118  -22.6874    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.2973  -22.2839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5456  -21.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3455  -19.6003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8158  -20.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4342  -19.4075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6140  -18.8188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4241  -18.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0725  -18.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9657  -19.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7758  -19.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3214  -19.7431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0603  -20.5174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.1226  -19.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  6  1  0
  5  2  1  0
  2  8  1  0
  7  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10 12  1  0
 11 12  1  0
 11 14  1  0
 12 16  1  0
 15 13  1  0
 13 14  1  0
 15 16  1  0
 16 17  1  0
 17 25  1  0
 24 15  2  0
 11 18  1  1
  7 19  1  1
 12 20  1  6
  8 21  1  6
  5 22  2  0
 16 23  1  1
 24 25  1  0
 14 26  1  1
 24 27  1  0
 27 28  1  0
 27 29  1  6
 28 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4536937

    ---

Associated Targets(Human)

NR1H4 Tclin Bile acid receptor FXR (6228 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.67Molecular Weight (Monoisotopic): 440.3290AlogP: 6.45#Rotatable Bonds: 4
Polar Surface Area: 54.37Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.64CX LogD: 5.64
Aromatic Rings: Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: 3.29

References

1. Luan ZL, Huo XK, Dong PP, Tian XG, Sun CP, Lv X, Feng L, Ning J, Wang C, Zhang BJ, Ma XC..  (2019)  Highly potent non-steroidal FXR agonists protostane-type triterpenoids: Structure-activity relationship and mechanism.,  182  [PMID:31494470] [10.1016/j.ejmech.2019.111652]

Source