N-(3-((1H-Benzo[d]imidazol-1-yl)methyl)benzyl)-2-acetamidoacetamide

ID: ALA4537025

PubChem CID: 155548078

Max Phase: Preclinical

Molecular Formula: C19H20N4O2

Molecular Weight: 336.40

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)NCC(=O)NCc1cccc(Cn2cnc3ccccc32)c1

Standard InChI:  InChI=1S/C19H20N4O2/c1-14(24)20-11-19(25)21-10-15-5-4-6-16(9-15)12-23-13-22-17-7-2-3-8-18(17)23/h2-9,13H,10-12H2,1H3,(H,20,24)(H,21,25)

Standard InChI Key:  QUFVTQKNGAUNNV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    4.9471  -26.7981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9460  -27.6217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6582  -28.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3719  -27.6212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3691  -26.7945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6564  -26.3851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2338  -28.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5264  -27.6206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4406  -26.8058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6372  -26.6353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7745  -27.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2265  -27.3468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4262  -27.5146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1728  -28.2936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7217  -28.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5199  -28.7300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0844  -28.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7956  -27.6190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5081  -28.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5094  -28.8478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2193  -27.6168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9266  -28.0261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6347  -27.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3420  -28.0274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6355  -26.8010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 12  1  0
 11  8  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  4 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4537025

    ---

Associated Targets(Human)

A-375 (9258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
IDO1 Tchem Indoleamine 2,3-dioxygenase (6650 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 336.40Molecular Weight (Monoisotopic): 336.1586AlogP: 1.84#Rotatable Bonds: 6
Polar Surface Area: 76.02Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.11CX Basic pKa: 5.30CX LogP: 1.05CX LogD: 1.04
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.72Np Likeness Score: -1.68

References

1. Serafini M, Torre E, Aprile S, Grosso ED, Gesù A, Griglio A, Colombo G, Travelli C, Paiella S, Adamo A, Orecchini E, Coletti A, Pallotta MT, Ugel S, Massarotti A, Pirali T, Fallarini S..  (2020)  Discovery of Highly Potent Benzimidazole Derivatives as Indoleamine 2,3-Dioxygenase-1 (IDO1) Inhibitors: From Structure-Based Virtual Screening to in Vivo Pharmacodynamic Activity.,  63  (6): [PMID:32150677] [10.1021/acs.jmedchem.9b01809]

Source