The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(furan-2-ylmethyl)-N-(2-(6-(naphthalen-2-yl)imidazo[2,1-b]thiazol-3-yl)ethyl)-3-(trifluoromethyl)benzenesulfonamide ID: ALA4537027
PubChem CID: 4603135
Max Phase: Preclinical
Molecular Formula: C29H22F3N3O3S2
Molecular Weight: 581.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(c1cccc(C(F)(F)F)c1)N(CCc1csc2nc(-c3ccc4ccccc4c3)cn12)Cc1ccco1
Standard InChI: InChI=1S/C29H22F3N3O3S2/c30-29(31,32)23-7-3-9-26(16-23)40(36,37)34(17-25-8-4-14-38-25)13-12-24-19-39-28-33-27(18-35(24)28)22-11-10-20-5-1-2-6-21(20)15-22/h1-11,14-16,18-19H,12-13,17H2
Standard InChI Key: GBOUQEOVPRWXMF-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
14.3048 -14.0381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5921 -13.6254 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.5911 -14.4490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4708 -10.7829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2961 -10.7829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2182 -9.9985 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.8834 -9.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5528 -9.9937 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2183 -9.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9602 -8.7226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1353 -8.7260 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4426 -8.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2643 -8.1389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5821 -6.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1036 -7.3056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4078 -6.7166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7435 -7.4685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5607 -7.5525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0430 -6.8855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7025 -6.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8863 -6.0520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7810 -11.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4452 -12.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9302 -12.8722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7510 -12.7861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2360 -13.4538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9850 -14.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6526 -14.7233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3204 -14.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0654 -13.4534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7737 -13.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2945 -13.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4744 -13.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1378 -13.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6275 -14.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4459 -14.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9898 -12.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3260 -11.7071 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.1689 -12.5465 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.5703 -11.7414 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 8 1 0
7 6 1 0
6 4 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 7 2 0
10 12 1 0
12 13 2 0
13 17 1 0
16 14 1 0
14 15 2 0
15 12 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 16 2 0
5 22 1 0
22 23 1 0
23 24 1 0
24 2 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 26 1 0
2 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
33 37 1 0
37 38 1 0
37 39 1 0
37 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 581.64Molecular Weight (Monoisotopic): 581.1055AlogP: 7.26#Rotatable Bonds: 8Polar Surface Area: 67.82Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.51CX LogP: 6.24CX LogD: 6.24Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.19Np Likeness Score: -2.01
References 1. (2012) Entpd5 inhibitors,