(E)-3-(4-(3,4,5-trimethoxybenzoyloxy)styryl)phenyl 3,4,5-trimethoxybenzoate

ID: ALA4537065

PubChem CID: 155548304

Max Phase: Preclinical

Molecular Formula: C34H32O10

Molecular Weight: 600.62

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(C(=O)Oc2ccc(/C=C/c3cccc(OC(=O)c4cc(OC)c(OC)c(OC)c4)c3)cc2)cc(OC)c1OC

Standard InChI:  InChI=1S/C34H32O10/c1-37-27-17-23(18-28(38-2)31(27)41-5)33(35)43-25-14-12-21(13-15-25)10-11-22-8-7-9-26(16-22)44-34(36)24-19-29(39-3)32(42-6)30(20-24)40-4/h7-20H,1-6H3/b11-10+

Standard InChI Key:  SZKQPDLAALKARD-ZHACJKMWSA-N

Molfile:  

 
     RDKit          2D

 44 47  0  0  0  0  0  0  0  0999 V2000
   27.8285   -5.6212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8273   -6.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5354   -6.8497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2450   -6.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2422   -5.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5336   -5.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5352   -7.6669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.2428   -8.0757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2426   -8.8929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9506   -7.6673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9484   -5.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6576   -5.6123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3638   -5.2011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0715   -5.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7771   -5.1998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7745   -4.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0603   -3.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3575   -4.3889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4801   -3.9695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.1899   -4.3745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8955   -3.9623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1941   -5.1917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5344   -9.2970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5338  -10.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2420  -10.5230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9521  -10.1102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9492   -9.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6048   -4.3700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3099   -3.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3062   -3.1404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5914   -2.7356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8892   -3.1494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8258  -10.5215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.2428  -11.3402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6612  -10.5165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0195   -4.3638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0113   -2.7273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.5844   -1.9184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1184  -10.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5356  -11.7496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6638  -11.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7253   -3.9519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0060   -1.9101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8732   -1.5160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  5 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 16 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
  9 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27  9  1  0
 21 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 21  1  0
 24 33  1  0
 25 34  1  0
 26 35  1  0
 29 36  1  0
 30 37  1  0
 31 38  1  0
 33 39  1  0
 34 40  1  0
 35 41  1  0
 36 42  1  0
 37 43  1  0
 38 44  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4537065

    ---

Associated Targets(Human)

NCI-H1703 (410 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PC-9 (1037 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FASN Tchem Fatty acid synthase (3390 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 600.62Molecular Weight (Monoisotopic): 600.1995AlogP: 6.35#Rotatable Bonds: 12
Polar Surface Area: 107.98Molecular Species: NEUTRALHBA: 10HBD:
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 6.69CX LogD: 6.69
Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.10Np Likeness Score: -0.04

References

1. Tan YJ, Ali A, Tee SY, Teo JT, Xi Y, Go ML, Lam Y..  (2019)  Galloyl esters of trans-stilbenes are inhibitors of FASN with anticancer activity on non-small cell lung cancer cells.,  182  [PMID:31422225] [10.1016/j.ejmech.2019.111597]

Source