The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3-(4-(3,4,5-trimethoxybenzoyloxy)styryl)phenyl 3,4,5-trimethoxybenzoate ID: ALA4537065
PubChem CID: 155548304
Max Phase: Preclinical
Molecular Formula: C34H32O10
Molecular Weight: 600.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)Oc2ccc(/C=C/c3cccc(OC(=O)c4cc(OC)c(OC)c(OC)c4)c3)cc2)cc(OC)c1OC
Standard InChI: InChI=1S/C34H32O10/c1-37-27-17-23(18-28(38-2)31(27)41-5)33(35)43-25-14-12-21(13-15-25)10-11-22-8-7-9-26(16-22)44-34(36)24-19-29(39-3)32(42-6)30(20-24)40-4/h7-20H,1-6H3/b11-10+
Standard InChI Key: SZKQPDLAALKARD-ZHACJKMWSA-N
Molfile:
RDKit 2D
44 47 0 0 0 0 0 0 0 0999 V2000
27.8285 -5.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8273 -6.4408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5354 -6.8497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2450 -6.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2422 -5.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5336 -5.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5352 -7.6669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2428 -8.0757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2426 -8.8929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9506 -7.6673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9484 -5.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6576 -5.6123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3638 -5.2011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0715 -5.6104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7771 -5.1998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7745 -4.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0603 -3.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3575 -4.3889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4801 -3.9695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1899 -4.3745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8955 -3.9623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1941 -5.1917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5344 -9.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5338 -10.1135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2420 -10.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9521 -10.1102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9492 -9.2952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6048 -4.3700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3099 -3.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3062 -3.1404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5914 -2.7356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8892 -3.1494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8258 -10.5215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2428 -11.3402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6612 -10.5165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0195 -4.3638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0113 -2.7273 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.5844 -1.9184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1184 -10.1124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5356 -11.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6638 -11.3337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7253 -3.9519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0060 -1.9101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8732 -1.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
5 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
9 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 9 1 0
21 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 21 1 0
24 33 1 0
25 34 1 0
26 35 1 0
29 36 1 0
30 37 1 0
31 38 1 0
33 39 1 0
34 40 1 0
35 41 1 0
36 42 1 0
37 43 1 0
38 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 600.62Molecular Weight (Monoisotopic): 600.1995AlogP: 6.35#Rotatable Bonds: 12Polar Surface Area: 107.98Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.69CX LogD: 6.69Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.10Np Likeness Score: -0.04
References 1. Tan YJ, Ali A, Tee SY, Teo JT, Xi Y, Go ML, Lam Y.. (2019) Galloyl esters of trans-stilbenes are inhibitors of FASN with anticancer activity on non-small cell lung cancer cells., 182 [PMID:31422225 ] [10.1016/j.ejmech.2019.111597 ]