3-[4-[[5-(3-chloro-2-methyl-phenyl)-2-furyl]methylene]-3-methyl-5-oxo-pyrazol-1-yl]benzoic acid

ID: ALA4537077

PubChem CID: 5926081

Max Phase: Preclinical

Molecular Formula: C23H17ClN2O4

Molecular Weight: 420.85

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=NN(c2cccc(C(=O)O)c2)C(=O)/C1=C/c1ccc(-c2cccc(Cl)c2C)o1

Standard InChI:  InChI=1S/C23H17ClN2O4/c1-13-18(7-4-8-20(13)24)21-10-9-17(30-21)12-19-14(2)25-26(22(19)27)16-6-3-5-15(11-16)23(28)29/h3-12H,1-2H3,(H,28,29)/b19-12+

Standard InChI Key:  UAHKSRRXJNYYCS-XDHOZWIPSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   23.9448  -19.0849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6487  -18.6776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3487  -19.0843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3487  -19.8955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6512  -20.3020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9448  -19.9007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0523  -18.6768    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0523  -17.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8651  -17.5941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3382  -18.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8425  -18.9266    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.1532  -18.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0730  -16.8066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8605  -16.5987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0757  -15.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9262  -15.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2129  -16.5194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5566  -17.0397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9962  -16.7314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5720  -16.1561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3558  -16.3641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5638  -17.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9940  -17.7249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2095  -17.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6340  -18.0910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2060  -18.5083    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   25.3487  -17.4384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2411  -18.6774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5375  -19.0849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2411  -17.8665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  3  7  1  0
  8  7  1  0
  8  9  1  0
  9 10  1  0
 11 10  2  0
  7 11  1  0
 10 12  1  0
  9 13  2  0
 13 14  1  0
 15 14  2  0
 15 16  1  0
 16 17  2  0
 18 17  1  0
 14 18  1  0
 19 17  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
 24 25  1  0
 23 26  1  0
  8 27  2  0
  1 28  1  0
 28 29  1  0
 28 30  2  0
M  END

Associated Targets(Human)

GALK1 Tbio Galactokinase (959 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 420.85Molecular Weight (Monoisotopic): 420.0877AlogP: 5.41#Rotatable Bonds: 4
Polar Surface Area: 83.11Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.87CX Basic pKa: CX LogP: 4.98CX LogD: 1.75
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.57Np Likeness Score: -1.44

References

1.  (2013)  Galactokinase inhibitors, 

Source