The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((1-benzylpiperidin-4-yl)amino)-6-methoxy-2-(4-phenylpiperazin-1-yl)quinazolin-7-ol ID: ALA4537137
PubChem CID: 137028680
Max Phase: Preclinical
Molecular Formula: C31H36N6O2
Molecular Weight: 524.67
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(NC3CCN(Cc4ccccc4)CC3)nc(N3CCN(c4ccccc4)CC3)nc2cc1O
Standard InChI: InChI=1S/C31H36N6O2/c1-39-29-20-26-27(21-28(29)38)33-31(37-18-16-36(17-19-37)25-10-6-3-7-11-25)34-30(26)32-24-12-14-35(15-13-24)22-23-8-4-2-5-9-23/h2-11,20-21,24,38H,12-19,22H2,1H3,(H,32,33,34)
Standard InChI Key: HLCTXDGPRCMXBV-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
15.4922 -23.7439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4911 -24.5676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2032 -24.9765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2014 -23.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9142 -23.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9149 -24.5635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6276 -24.9705 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3400 -24.5597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3353 -23.7334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6220 -23.3259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6177 -22.5046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3274 -22.0882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0367 -22.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7442 -22.0868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7441 -21.2652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0303 -20.8581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3165 -21.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0534 -24.9655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4512 -20.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1636 -21.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0523 -25.7834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7616 -26.1933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4702 -25.7813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4690 -24.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7592 -24.5446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1629 -22.0817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8745 -22.4933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8707 -20.8502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5828 -21.2539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5858 -22.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1795 -26.1914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1783 -27.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8893 -27.4222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6021 -27.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5994 -26.1880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8877 -25.7791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7803 -23.3314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7801 -22.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7789 -24.9756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
8 18 1 0
15 19 1 0
19 20 1 0
18 21 1 0
18 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
20 26 2 0
26 27 1 0
27 30 2 0
29 28 2 0
28 20 1 0
29 30 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
23 31 1 0
1 37 1 0
37 38 1 0
2 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.67Molecular Weight (Monoisotopic): 524.2900AlogP: 4.75#Rotatable Bonds: 7Polar Surface Area: 76.99Molecular Species: ZWITTERIONHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.76CX Basic pKa: 9.16CX LogP: 3.74CX LogD: 2.94Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.36Np Likeness Score: -1.02
References 1. Bouchut A, Rotili D, Pierrot C, Valente S, Lafitte S, Schultz J, Hoglund U, Mazzone R, Lucidi A, Fabrizi G, Pechalrieu D, Arimondo PB, Skinner-Adams TS, Chua MJ, Andrews KT, Mai A, Khalife J.. (2019) Identification of novel quinazoline derivatives as potent antiplasmodial agents., 161 [PMID:30366254 ] [10.1016/j.ejmech.2018.10.041 ]