The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,6-dimethyl-5-phenyl-2-{[4-(o-ethoxyphenyl)-1-piperazinyl]methyl}pyrrolo[3,4-c]pyrrole-1,3(2H,5H)-dione ID: ALA4537150
PubChem CID: 155548701
Max Phase: Preclinical
Molecular Formula: C27H30N4O3
Molecular Weight: 458.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccccc1N1CCN(CN2C(=O)c3c(c(C)n(-c4ccccc4)c3C)C2=O)CC1
Standard InChI: InChI=1S/C27H30N4O3/c1-4-34-23-13-9-8-12-22(23)29-16-14-28(15-17-29)18-30-26(32)24-19(2)31(20(3)25(24)27(30)33)21-10-6-5-7-11-21/h5-13H,4,14-18H2,1-3H3
Standard InChI Key: SEZMUHRGPNOBDH-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
13.0688 -4.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1076 -2.7416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6061 -3.3956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8867 -3.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8604 -3.8454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6366 -4.1252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1427 -3.4733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6790 -2.7909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9588 -2.0148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8665 -4.9174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7898 -4.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8746 -1.9503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9672 -3.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3569 -4.2266 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9153 -4.9276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3014 -5.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1262 -5.6830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5633 -4.9823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1757 -4.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7820 -3.3725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3911 -2.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5672 -2.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1334 -3.3233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5293 -4.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3519 -4.0726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5126 -6.4071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0734 -7.1067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4595 -7.8348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2849 -7.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7224 -7.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3338 -6.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7694 -5.7343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5940 -5.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0296 -5.0608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 2 0
2 3 1 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
8 9 2 0
6 10 2 0
1 11 1 0
2 12 1 0
7 13 1 0
13 14 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
3 20 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
17 26 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.56Molecular Weight (Monoisotopic): 458.2318AlogP: 3.87#Rotatable Bonds: 6Polar Surface Area: 58.02Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.25CX LogP: 4.34CX LogD: 4.34Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.53Np Likeness Score: -1.30
References 1. Redzicka A, Szczukowski Ł, Kochel A, Wiatrak B, Gębczak K, Czyżnikowska Ż.. (2019) COX-1/COX-2 inhibition activities and molecular docking study of newly designed and synthesized pyrrolo[3,4-c]pyrrole Mannich bases., 27 (17): [PMID:31345747 ] [10.1016/j.bmc.2019.07.033 ]