5-(2-Methylpyridin-4-yl)-N-(4-morpholinophenyl)-4-phenoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amine

ID: ALA4537152

PubChem CID: 155548702

Max Phase: Preclinical

Molecular Formula: C28H26N6O2

Molecular Weight: 478.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2c[nH]c3nc(Nc4ccc(N5CCOCC5)cc4)nc(Oc4ccccc4)c23)ccn1

Standard InChI:  InChI=1S/C28H26N6O2/c1-19-17-20(11-12-29-19)24-18-30-26-25(24)27(36-23-5-3-2-4-6-23)33-28(32-26)31-21-7-9-22(10-8-21)34-13-15-35-16-14-34/h2-12,17-18H,13-16H2,1H3,(H2,30,31,32,33)

Standard InChI Key:  FHRXPDHIUFVHFK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   39.2238   -9.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2226  -10.2585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.9307  -10.6674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9289   -9.0301    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.6375   -9.4353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6423  -10.2539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4223  -10.5024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8997   -9.8373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4146   -9.1779    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.5160   -9.0305    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.8083   -9.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1007   -9.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3935   -9.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3933  -10.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1061  -10.6635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8103  -10.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6862  -10.6650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.9317  -11.4846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.2245  -11.8941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9794  -10.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2745  -10.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2715  -11.4771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9797  -11.8868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6909  -11.4789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5195  -11.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8128  -11.8947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8135  -12.7128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5267  -13.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2304  -12.7091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6781  -11.2735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1331  -11.8839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3895  -12.6590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1906  -12.8249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.7347  -12.2095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4754  -11.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5356  -12.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
  3 18  1  0
 18 19  1  0
 17 20  1  0
 17 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 19 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 19  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
  7 30  1  0
 34 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4537152

    ---

Associated Targets(Human)

ITK Tclin Tyrosine-protein kinase ITK/TSK (3699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 478.56Molecular Weight (Monoisotopic): 478.2117AlogP: 5.70#Rotatable Bonds: 6
Polar Surface Area: 88.19Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.26CX Basic pKa: 5.34CX LogP: 5.18CX LogD: 5.18
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.32Np Likeness Score: -1.21

References

1. Tang G, Liu L, Wang X, Pan Z..  (2019)  Discovery of 7H-pyrrolo[2,3-d]pyrimidine derivatives as selective covalent irreversible inhibitors of interleukin-2-inducible T-cell kinase (Itk).,  173  [PMID:30999237] [10.1016/j.ejmech.2019.03.055]

Source