rac-N-[4-[[3-[[5-(Trifluoromethyl)-2-pyridyl]oxy]phenyl]methylene]cyclohexyl]pyridine-2-carboxamide

ID: ALA4537201

PubChem CID: 71543951

Max Phase: Preclinical

Molecular Formula: C25H22F3N3O2

Molecular Weight: 453.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NC1CCC(=Cc2cccc(Oc3ccc(C(F)(F)F)cn3)c2)CC1)c1ccccn1

Standard InChI:  InChI=1S/C25H22F3N3O2/c26-25(27,28)19-9-12-23(30-16-19)33-21-5-3-4-18(15-21)14-17-7-10-20(11-8-17)31-24(32)22-6-1-2-13-29-22/h1-6,9,12-16,20H,7-8,10-11H2,(H,31,32)/b17-14-

Standard InChI Key:  LVYURVZCXFWMGP-VKAVYKQESA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    4.1985   -9.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1974  -10.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9122  -10.8027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6287  -10.3893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6258   -9.5589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9104   -9.1497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4858   -9.1468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8356   -8.7715    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.3480   -8.2956    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.6800   -9.4534    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.3437  -10.8007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0576  -10.3871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7693  -10.7989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4827  -10.3860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4819   -9.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7617   -9.1489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0513   -9.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1977  -10.7977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9116  -10.3845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6235  -10.8009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3354  -10.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3388   -9.5657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6241   -9.1518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9059   -9.5633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0544   -9.1553    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7677   -9.5697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4833   -9.1591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7655  -10.3946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1956   -9.5760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9106   -9.1662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9133   -8.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1949   -7.9260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4828   -8.3382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
  1  7  1  0
  4 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 14 18  1  0
 18 19  2  0
 19 20  1  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 27  1  0
M  END

Associated Targets(Human)

FAAH Tchem Anandamide amidohydrolase (3465 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Faah Anandamide amidohydrolase (3907 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 453.46Molecular Weight (Monoisotopic): 453.1664AlogP: 6.04#Rotatable Bonds: 5
Polar Surface Area: 64.11Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.13CX LogP: 5.31CX LogD: 5.31
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -1.48

References

1. Bhuniya D, Kharul RK, Hajare A, Shaikh N, Bhosale S, Balwe S, Begum F, De S, Athavankar S, Joshi D, Madgula V, Joshi K, Raje AA, Meru AV, Magdum A, Mookhtiar KA, Barbhaiya R..  (2019)  Discovery and evaluation of novel FAAH inhibitors in neuropathic pain model.,  29  (2): [PMID:30503633] [10.1016/j.bmcl.2018.11.048]

Source