The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(5-Methyl-2-((4-morpholinophenyl)amino)pyrimidin-4-yl)-4,5,6,7-tetrahydrofuro[3,2-c]pyridine-5-carbonyl)benzonitrile ID: ALA4537207
PubChem CID: 155548399
Max Phase: Preclinical
Molecular Formula: C30H28N6O3
Molecular Weight: 520.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1-c1cc2c(o1)CCN(C(=O)c1ccc(C#N)cc1)C2
Standard InChI: InChI=1S/C30H28N6O3/c1-20-18-32-30(33-24-6-8-25(9-7-24)35-12-14-38-15-13-35)34-28(20)27-16-23-19-36(11-10-26(23)39-27)29(37)22-4-2-21(17-31)3-5-22/h2-9,16,18H,10-15,19H2,1H3,(H,32,33,34)
Standard InChI Key: LSDGLVLQKFWODR-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
4.6101 -11.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6101 -12.1217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3195 -12.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3195 -10.8835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0289 -11.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0289 -12.1182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8069 -12.3697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2894 -11.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8069 -11.0449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1076 -11.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5156 -12.4196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3362 -12.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7497 -11.7076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3326 -10.9934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5134 -10.9966 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7428 -10.2802 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5642 -10.2773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9709 -10.9909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7915 -10.9883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2025 -10.2745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7829 -9.5659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9637 -9.5719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1063 -13.1310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0204 -10.2700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4312 -10.9816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2490 -10.9797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6621 -10.2676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2472 -9.5601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4232 -9.5605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9030 -12.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1906 -12.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9042 -13.3526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1882 -11.3034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4766 -10.8918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7685 -11.3056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7729 -12.1311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4804 -12.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0532 -10.8951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3456 -10.4896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
11 23 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
20 24 1 0
2 30 1 0
30 31 1 0
30 32 2 0
31 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 31 1 0
38 39 3 0
35 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.59Molecular Weight (Monoisotopic): 520.2223AlogP: 4.70#Rotatable Bonds: 5Polar Surface Area: 107.52Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.30CX LogP: 4.27CX LogD: 4.27Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.40Np Likeness Score: -1.61
References 1. Wang Y, Huang W, Xin M, Chen P, Gui L, Zhao X, Zhu X, Luo H, Cong X, Wang J, Liu F.. (2019) Discovery of potent anti-inflammatory 4-(4,5,6,7-tetrahydrofuro[3,2-c]pyridin-2-yl) pyrimidin-2-amines for use as Janus kinase inhibitors., 27 (12): [PMID:30926315 ] [10.1016/j.bmc.2019.03.048 ]