The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-6-(Cyclopentyloxy)-7-methoxy-N,1-diphenyl-3,4-dihydroisoquinoline-3-carboxamide ID: ALA4537270
PubChem CID: 155548709
Max Phase: Preclinical
Molecular Formula: C28H28N2O3
Molecular Weight: 440.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC1CCCC1)CC(C(=O)Nc1ccccc1)N=C2c1ccccc1
Standard InChI: InChI=1S/C28H28N2O3/c1-32-25-18-23-20(17-26(25)33-22-14-8-9-15-22)16-24(28(31)29-21-12-6-3-7-13-21)30-27(23)19-10-4-2-5-11-19/h2-7,10-13,17-18,22,24H,8-9,14-16H2,1H3,(H,29,31)
Standard InChI Key: NDHYRPVCUXDJEO-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
15.0966 -4.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0954 -5.5683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8102 -5.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8083 -4.3283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5236 -4.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5271 -5.5703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2462 -5.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9664 -5.5644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9630 -4.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2393 -4.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2484 -6.8064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3821 -4.3287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3819 -3.5038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3807 -5.9801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6667 -5.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0550 -3.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7999 -2.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9749 -2.2358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7204 -3.0204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6761 -4.3168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3917 -4.7270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6735 -3.4919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1048 -4.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8200 -4.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5327 -4.3106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5306 -3.4849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8098 -3.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1002 -3.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5350 -7.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5372 -8.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2528 -8.4564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9662 -8.0420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9640 -7.2170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
7 11 1 0
1 12 1 0
12 13 1 0
2 14 1 0
14 15 1 0
13 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 13 1 0
9 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
11 29 1 0
11 33 2 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.54Molecular Weight (Monoisotopic): 440.2100AlogP: 5.42#Rotatable Bonds: 6Polar Surface Area: 59.92Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.51CX Basic pKa: 3.19CX LogP: 5.87CX LogD: 5.87Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: -0.13
References 1. Liao Y, Jia X, Tang Y, Li S, Zang Y, Wang L, Cui ZN, Song G.. (2019) Discovery of novel inhibitors of phosphodiesterase 4 with 1-phenyl-3,4-dihydroisoquinoline scaffold: Structure-based drug design and fragment identification., 29 (22): [PMID:31610942 ] [10.1016/j.bmcl.2019.126720 ]