4-(cyclooctanecarboxamido)phenyl benzenesulfonate

ID: ALA4537293

PubChem CID: 155548086

Max Phase: Preclinical

Molecular Formula: C21H25NO4S

Molecular Weight: 387.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(OS(=O)(=O)c2ccccc2)cc1)C1CCCCCCC1

Standard InChI:  InChI=1S/C21H25NO4S/c23-21(17-9-5-2-1-3-6-10-17)22-18-13-15-19(16-14-18)26-27(24,25)20-11-7-4-8-12-20/h4,7-8,11-17H,1-3,5-6,9-10H2,(H,22,23)

Standard InChI Key:  SQJFTHOUCMXTJO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   22.0931  -25.7580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5058  -26.4679    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.9142  -25.7555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9241  -25.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9230  -26.4702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6310  -26.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3407  -26.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3379  -25.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6292  -25.2418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0440  -25.2358    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.7533  -25.6418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4594  -25.2305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7563  -26.4589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2150  -26.8783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7995  -26.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0928  -26.4679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3870  -26.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3878  -27.6936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1003  -28.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8032  -27.6896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4128  -24.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4316  -25.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8687  -25.7789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8231  -23.8073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0041  -23.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4410  -24.4158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0495  -25.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
  5 14  1  0
 14  2  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 21 22  1  0
 22 23  1  0
 21 24  1  0
 24 25  1  0
 25 26  1  0
 26 12  1  0
 12 27  1  0
 27 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4537293

    ---

Associated Targets(Human)

ENPP2 Tchem Autotaxin (2645 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ENPP1 Tchem Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 (635 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ENPP3 Tchem Ectonucleotide pyrophosphatase/phosphodiesterase family member 3 (241 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 387.50Molecular Weight (Monoisotopic): 387.1504AlogP: 4.75#Rotatable Bonds: 5
Polar Surface Area: 72.47Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 5.43CX LogD: 5.43
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.75Np Likeness Score: -1.19

References

1. Semreen MH, El-Gamal MI, Ullah S, Jalil S, Zaib S, Anbar HS, Lecka J, Sévigny J, Iqbal J..  (2019)  Synthesis, biological evaluation, and molecular docking study of sulfonate derivatives as nucleotide pyrophosphatase/phosphodiesterase (NPP) inhibitors.,  27  (13): [PMID:31088715] [10.1016/j.bmc.2019.04.031]

Source