The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-aminophenyl)-4-(((3,6-dimethyl-4-oxo-3,4-dihydroquinazolin-2-yl)thio)methyl)benzamide ID: ALA4537439
PubChem CID: 155548219
Max Phase: Preclinical
Molecular Formula: C24H22N4O2S
Molecular Weight: 430.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2nc(SCc3ccc(C(=O)Nc4ccccc4N)cc3)n(C)c(=O)c2c1
Standard InChI: InChI=1S/C24H22N4O2S/c1-15-7-12-20-18(13-15)23(30)28(2)24(27-20)31-14-16-8-10-17(11-9-16)22(29)26-21-6-4-3-5-19(21)25/h3-13H,14,25H2,1-2H3,(H,26,29)
Standard InChI Key: XGDNKBODTIJRPI-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
16.3548 -21.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3536 -21.8271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0617 -22.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0599 -20.5987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7685 -21.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7719 -21.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4803 -22.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1900 -21.8188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1866 -20.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4736 -20.5885 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4826 -23.0469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8930 -20.5874 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.6020 -20.9938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3085 -20.5830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0168 -20.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7227 -20.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7206 -19.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0067 -19.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3037 -19.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4265 -19.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1360 -19.7573 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4229 -18.5346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8419 -19.3456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5499 -19.7535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2553 -19.3424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2521 -18.5244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5376 -18.1191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8351 -18.5324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5518 -20.5706 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8988 -22.2255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6456 -22.2351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
7 11 2 0
9 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
24 29 1 0
8 30 1 0
2 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.53Molecular Weight (Monoisotopic): 430.1463AlogP: 4.37#Rotatable Bonds: 5Polar Surface Area: 90.01Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.58CX LogP: 4.77CX LogD: 4.77Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.28Np Likeness Score: -1.71
References 1. Cheng C, Yun F, He J, Ullah S, Yuan Q.. (2019) Design, synthesis and biological evaluation of novel thioquinazolinone-based 2-aminobenzamide derivatives as potent histone deacetylase (HDAC) inhibitors., 173 [PMID:31003060 ] [10.1016/j.ejmech.2019.04.017 ]