(S)-4-[((1S,2S,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]octan-2-yl)-fluoromethyl]-6-methoxyquinoline

ID: ALA4537454

PubChem CID: 44234648

Max Phase: Preclinical

Molecular Formula: C20H25FN2O

Molecular Weight: 328.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@H]1C[N@]2CC[C@H]1C[C@@H]2[C@H](F)c1ccnc2ccc(OC)cc12

Standard InChI:  InChI=1S/C20H25FN2O/c1-3-13-12-23-9-7-14(13)10-19(23)20(21)16-6-8-22-18-5-4-15(24-2)11-17(16)18/h4-6,8,11,13-14,19-20H,3,7,9-10,12H2,1-2H3/t13-,14-,19+,20+/m0/s1

Standard InChI Key:  AIGRCCSKIYGXPT-AFHBHXEDSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    8.3617   -4.7881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4995   -5.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7946   -6.2640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7864   -5.4390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0816   -6.6744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4995   -4.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6312   -3.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3244   -4.0378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4737   -3.1756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0457   -5.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0858   -7.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7989   -7.9140    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3603   -6.2723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4488   -2.3505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9835   -4.4566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3603   -7.9222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0733   -5.0245    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.6555   -6.6744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5118   -7.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6472   -7.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5118   -6.6703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9341   -6.2723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7067   -5.8122    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5989   -3.6192    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.1470   -1.9189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2296   -6.6934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  1  0
  4  2  1  0
  5  3  1  0
  6  2  1  0
  8 15  1  0
  9  7  1  0
 10  1  1  0
 11  5  1  0
 12 19  2  0
 13  5  2  0
  9 14  1  1
 15 10  1  0
 16 11  2  0
  4 17  1  1
 18 13  1  0
 19 21  1  0
 20 18  2  0
 21  3  2  0
 22 18  1  0
  2 23  1  6
  8 24  1  6
  9  8  1  0
  8  6  1  0
 12 11  1  0
 16 20  1  0
 14 25  1  0
 22 26  1  0
  1  7  1  6
M  END

Associated Targets(Human)

HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Streptococcus pneumoniae (31063 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 328.43Molecular Weight (Monoisotopic): 328.1951AlogP: 4.37#Rotatable Bonds: 4
Polar Surface Area: 25.36Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.06CX LogP: 3.71CX LogD: 2.96
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.83Np Likeness Score: 0.10

References

1. Wang X, Zeng Y, Sheng L, Larson P, Liu X, Zou X, Wang S, Guo K, Ma C, Zhang G, Cui H, Ferguson DM, Li Y, Zhang J, Aldrich CC..  (2019)  A Cinchona Alkaloid Antibiotic That Appears To Target ATP Synthase in Streptococcus pneumoniae.,  62  (5): [PMID:30779564] [10.1021/acs.jmedchem.8b01353]

Source