3-(2-(tert-butylamino)-1-(N-(4-((3,5-difluorobenzyl)oxy)benzyl)formamido)-2-oxoethyl)-6-chloro-1H-indole-2-carboxylic acid

ID: ALA4537477

PubChem CID: 155548484

Max Phase: Preclinical

Molecular Formula: C30H28ClF2N3O5

Molecular Weight: 584.02

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)NC(=O)C(c1c(C(=O)O)[nH]c2cc(Cl)ccc12)N(C=O)Cc1ccc(OCc2cc(F)cc(F)c2)cc1

Standard InChI:  InChI=1S/C30H28ClF2N3O5/c1-30(2,3)35-28(38)27(25-23-9-6-19(31)12-24(23)34-26(25)29(39)40)36(16-37)14-17-4-7-22(8-5-17)41-15-18-10-20(32)13-21(33)11-18/h4-13,16,27,34H,14-15H2,1-3H3,(H,35,38)(H,39,40)

Standard InChI Key:  UFEXLJCEZMUACH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
   41.6343   -7.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6306   -7.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3441   -8.2634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3475   -6.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0616   -7.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0593   -7.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8446   -8.1058    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.3323   -7.4385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8483   -6.7687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1054   -5.9847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9128   -5.8154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5551   -5.3701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.1700   -5.0315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.9774   -4.8622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.2346   -4.0783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.5277   -5.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.7723   -4.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9145   -8.2580    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   43.8122   -4.5862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2619   -3.9716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.7477   -5.5393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1973   -4.9247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4576   -4.1429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9080   -3.5286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0997   -3.6976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8437   -4.4865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3950   -5.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5484   -3.0838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.7413   -3.2541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1901   -2.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4476   -1.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8973   -1.2437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0891   -1.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8343   -2.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3863   -2.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5868   -6.2825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.1573   -7.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5678   -8.1564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.5718   -6.7275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.1537   -0.4595    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.0276   -2.3762    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  1  0
 10 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  1  0
  2 18  1  0
 12 19  1  0
 19 20  2  0
 12 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 11 36  2  0
  8 37  1  0
 37 38  1  0
 37 39  2  0
 32 40  1  0
 34 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4537477

    ---

Associated Targets(Human)

MDM2 Tchem p53-binding protein Mdm-2 (4545 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDM4 Tchem Protein Mdm4 (729 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 584.02Molecular Weight (Monoisotopic): 583.1686AlogP: 5.99#Rotatable Bonds: 10
Polar Surface Area: 111.73Molecular Species: ACIDHBA: 4HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.56CX Basic pKa: CX LogP: 5.11CX LogD: 1.75
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.20Np Likeness Score: -1.11

References

1. Neochoritis CG, Atmaj J, Twarda-Clapa A, Surmiak E, Skalniak L, Köhler LM, Muszak D, Kurpiewska K, Kalinowska-Tłuścik J, Beck B, Holak TA, Dömling A..  (2019)  Hitting on the move: Targeting intrinsically disordered protein states of the MDM2-p53 interaction.,  182  [PMID:31421630] [10.1016/j.ejmech.2019.111588]

Source