The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,6-dimethyl-5-(m-chlorophenyl)-2-[(4-phenyl-1-piperazinyl)methyl]pyrrolo[3,4-c]pyrrole-1,3(2H,5H)-dione ID: ALA4537499
PubChem CID: 155548534
Max Phase: Preclinical
Molecular Formula: C25H25ClN4O2
Molecular Weight: 448.95
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c2c(c(C)n1-c1cccc(Cl)c1)C(=O)N(CN1CCN(c3ccccc3)CC1)C2=O
Standard InChI: InChI=1S/C25H25ClN4O2/c1-17-22-23(18(2)30(17)21-10-6-7-19(26)15-21)25(32)29(24(22)31)16-27-11-13-28(14-12-27)20-8-4-3-5-9-20/h3-10,15H,11-14,16H2,1-2H3
Standard InChI Key: OAWOFNYKHPAPJB-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
4.9272 -17.4717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9661 -16.1362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4646 -16.7901 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7451 -16.4153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7188 -17.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4950 -17.5196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0010 -16.8679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5374 -16.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8172 -15.4094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7249 -18.3120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6483 -18.2480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7331 -15.3448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8255 -16.8941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2152 -17.6212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7736 -18.3222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1597 -19.0470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9845 -19.0775 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4216 -18.3767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0339 -17.6455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3709 -19.8016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9317 -20.5011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3178 -21.2291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1432 -21.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5807 -20.5545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1920 -19.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6406 -16.7671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2496 -16.0394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4258 -16.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9920 -16.7178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3879 -17.4464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2104 -17.4671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0345 -15.2889 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 2 0
2 3 1 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
8 9 2 0
6 10 2 0
1 11 1 0
2 12 1 0
7 13 1 0
13 14 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
17 20 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
3 26 1 0
28 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.95Molecular Weight (Monoisotopic): 448.1666AlogP: 4.12#Rotatable Bonds: 4Polar Surface Area: 48.79Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.51CX LogP: 4.75CX LogD: 4.74Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.56Np Likeness Score: -1.42
References 1. Redzicka A, Szczukowski Ł, Kochel A, Wiatrak B, Gębczak K, Czyżnikowska Ż.. (2019) COX-1/COX-2 inhibition activities and molecular docking study of newly designed and synthesized pyrrolo[3,4-c]pyrrole Mannich bases., 27 (17): [PMID:31345747 ] [10.1016/j.bmc.2019.07.033 ]