(R)-6-Amino-1'-benzyl-5-(1-(2,6-dichloro-3-fluorophenyl)ethoxy)[3,4'-bipyridin]-2'(1'H)-one

ID: ALA4537507

PubChem CID: 155548579

Max Phase: Preclinical

Molecular Formula: C25H20Cl2FN3O2

Molecular Weight: 484.36

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H](Oc1cc(-c2ccn(Cc3ccccc3)c(=O)c2)cnc1N)c1c(Cl)ccc(F)c1Cl

Standard InChI:  InChI=1S/C25H20Cl2FN3O2/c1-15(23-19(26)7-8-20(28)24(23)27)33-21-11-18(13-30-25(21)29)17-9-10-31(22(32)12-17)14-16-5-3-2-4-6-16/h2-13,15H,14H2,1H3,(H2,29,30)/t15-/m1/s1

Standard InChI Key:  APPXGMLAUWCONV-OAHLLOKOSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   29.4752   -4.9650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4741   -5.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1821   -6.1935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.8918   -5.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8890   -4.9614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1804   -4.5562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7682   -4.5522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7699   -3.7341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0662   -3.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3562   -3.7310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3544   -4.5492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0627   -4.9620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6002   -6.1916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0691   -2.5086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5951   -4.5502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5921   -3.7330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2982   -3.3217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0027   -3.7312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7084   -3.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7058   -2.5025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9916   -2.0968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2888   -2.5097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8828   -3.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0029   -4.5484    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   31.5772   -2.1079    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   34.4175   -3.7269    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.6499   -3.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6528   -2.5027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3624   -2.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3657   -1.2822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6589   -0.8703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9474   -1.2807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9476   -2.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
  1  7  1  0
  4 13  1  0
  9 14  2  0
  5 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 16 23  1  6
 18 24  1  0
 22 25  1  0
 19 26  1  0
 10 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4537507

    ---

Associated Targets(Human)

KARPAS-299 (888 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SH-SY5Y (11521 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H2228 (1030 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ALK Tclin ALK tyrosine kinase receptor (7132 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.36Molecular Weight (Monoisotopic): 483.0917AlogP: 6.13#Rotatable Bonds: 6
Polar Surface Area: 70.14Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.97CX LogP: 5.36CX LogD: 5.35
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -1.04

References

1. Chen W, Guo X, Zhang C, Ke D, Zhang G, Yu Y..  (2019)  Discovery of 2-aminopyridines bearing a pyridone moiety as potent ALK inhibitors to overcome the crizotinib-resistant mutants.,  183  [PMID:31569004] [10.1016/j.ejmech.2019.111734]

Source