The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-chloro-2-cyclohexyl-7-(3-(dimethylamino)propyl)-N-(1-isopropylpiperidin-4-yl)quinazolin-4-amine ID: ALA4537533
PubChem CID: 155548665
Max Phase: Preclinical
Molecular Formula: C27H42ClN5
Molecular Weight: 472.12
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)N1CCC(Nc2nc(C3CCCCC3)nc3cc(CCCN(C)C)c(Cl)cc23)CC1
Standard InChI: InChI=1S/C27H42ClN5/c1-19(2)33-15-12-22(13-16-33)29-27-23-18-24(28)21(11-8-14-32(3)4)17-25(23)30-26(31-27)20-9-6-5-7-10-20/h17-20,22H,5-16H2,1-4H3,(H,29,30,31)
Standard InChI Key: KCGODHPPITZISL-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
40.1152 -4.7587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.1141 -5.5782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8221 -5.9872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.8204 -4.3498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5290 -4.7551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5297 -5.5741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2383 -5.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9465 -5.5703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9418 -4.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2327 -4.3448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8179 -3.5326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.1090 -3.1261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1091 -2.3055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4043 -1.8991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6954 -2.3063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.6959 -3.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4053 -3.5353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9880 -1.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4096 -5.9840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7024 -5.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9965 -5.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9916 -6.7947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6988 -7.2060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4109 -6.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9887 -1.0799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2800 -2.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6558 -5.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3619 -5.5648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0712 -5.9707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7773 -5.5593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.6470 -4.3353 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
46.4866 -5.9652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7742 -4.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
4 11 1 0
11 12 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
15 18 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
2 19 1 0
18 25 1 0
18 26 1 0
8 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
9 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.12Molecular Weight (Monoisotopic): 471.3129AlogP: 6.11#Rotatable Bonds: 8Polar Surface Area: 44.29Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.71CX LogP: 6.09CX LogD: 2.11Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -1.30
References 1. Leenders R, Zijlmans R, van Bree B, van de Sande M, Trivarelli F, Damen E, Wegert A, Müller D, Ehlert JE, Feger D, Heidemann-Dinger C, Kubbutat M, Schächtele C, Lenstra DC, Mecinović J, Müller G.. (2019) Novel SAR for quinazoline inhibitors of EHMT1 and EHMT2., 29 (17): [PMID:31350126 ] [10.1016/j.bmcl.2019.06.012 ]