1-(5-bromo-2-methoxyphenyl)-3-(4-(methylsulfonyl)phenyl)prop-2-en-1-one

ID: ALA4537567

PubChem CID: 155548178

Max Phase: Preclinical

Molecular Formula: C17H15BrO4S

Molecular Weight: 395.27

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(Br)cc1C(=O)/C=C/c1ccc(S(C)(=O)=O)cc1

Standard InChI:  InChI=1S/C17H15BrO4S/c1-22-17-10-6-13(18)11-15(17)16(19)9-5-12-3-7-14(8-4-12)23(2,20)21/h3-11H,1-2H3/b9-5+

Standard InChI Key:  COZVLTWRNCURIY-WEVVVXLNSA-N

Molfile:  

 
     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
   19.0100   -6.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6055   -7.2474    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.4226   -7.2428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2358   -6.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2347   -6.8659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9427   -7.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6524   -6.8654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6495   -6.0428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9409   -5.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3557   -5.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0650   -6.0374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3526   -4.8143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7711   -5.6262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4804   -6.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4803   -6.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1888   -7.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8959   -6.8427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8902   -6.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1812   -5.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5280   -5.6379    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   14.3607   -7.2729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3620   -8.0901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6098   -8.0648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  4 20  1  0
  7 21  1  0
 21 22  1  0
 17  2  1  0
  2 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4537567

    ---

Associated Targets(Human)

MGC-803 (6426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HGC-27 (1452 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SGC-7901 (2773 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 395.27Molecular Weight (Monoisotopic): 393.9874AlogP: 3.76#Rotatable Bonds: 5
Polar Surface Area: 60.44Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.34CX LogD: 3.34
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.57Np Likeness Score: -0.72

References

1. Hossain M, Das U, Dimmock JR..  (2019)  Recent advances in α,β-unsaturated carbonyl compounds as mitochondrial toxins.,  183  [PMID:31539776] [10.1016/j.ejmech.2019.111687]

Source