N4-(4'-methyl-[1,1'-biphenyl]-4-yl)-N2-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-2,4-diamine

ID: ALA4537569

PubChem CID: 155548179

Max Phase: Preclinical

Molecular Formula: C26H33N5

Molecular Weight: 415.59

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2ccc(Nc3ccnc(NC4CC(C)(C)NC(C)(C)C4)n3)cc2)cc1

Standard InChI:  InChI=1S/C26H33N5/c1-18-6-8-19(9-7-18)20-10-12-21(13-11-20)28-23-14-15-27-24(30-23)29-22-16-25(2,3)31-26(4,5)17-22/h6-15,22,31H,16-17H2,1-5H3,(H2,27,28,29,30)

Standard InChI Key:  CZMBEQDOKLLPBT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   18.9192  -29.4643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1020  -29.4643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5106  -30.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9877  -27.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4004  -28.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8088  -27.5220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8661  -28.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8649  -29.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5730  -29.8714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2826  -29.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2798  -28.6393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5712  -28.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9910  -29.8695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6980  -29.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5687  -27.4169    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8598  -27.0104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8607  -26.1939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1526  -25.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4452  -26.1983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4502  -27.0197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1589  -27.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4008  -29.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1087  -28.6468    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6894  -28.6451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7391  -25.7945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7369  -24.9762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0283  -24.5707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3214  -24.9825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3275  -25.8039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0367  -26.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6114  -24.5779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
 12 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 14 22  1  0
 14 24  1  0
 22  2  1  0
  2 23  1  0
 23  5  1  0
  5 24  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 19 25  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4537569

    ---

Associated Targets(Human)

A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

dengue virus type 2 (2400 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.59Molecular Weight (Monoisotopic): 415.2736AlogP: 5.92#Rotatable Bonds: 5
Polar Surface Area: 61.87Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.34CX LogP: 5.43CX LogD: 2.64
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.48Np Likeness Score: -1.00

References

1. Leal ES, Adler NS, Fernández GA, Gebhard LG, Battini L, Aucar MG, Videla M, Monge ME, Hernández de Los Ríos A, Acosta Dávila JA, Morell ML, Cordo SM, García CC, Gamarnik AV, Cavasotto CN, Bollini M..  (2019)  De novo design approaches targeting an envelope protein pocket to identify small molecules against dengue virus.,  182  [PMID:31472473] [10.1016/j.ejmech.2019.111628]

Source