The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,6S)-2-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(o-tolylsulfonyl)-1,2,5,6-tetrahydropyridine-3-carboxamide ID: ALA4537588
PubChem CID: 58360958
Max Phase: Preclinical
Molecular Formula: C25H22Cl2N2O3S
Molecular Weight: 501.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1S(=O)(=O)N1[C@@H](c2cccc(Cl)c2)C(C(N)=O)=CC[C@H]1c1ccc(Cl)cc1
Standard InChI: InChI=1S/C25H22Cl2N2O3S/c1-16-5-2-3-8-23(16)33(31,32)29-22(17-9-11-19(26)12-10-17)14-13-21(25(28)30)24(29)18-6-4-7-20(27)15-18/h2-13,15,22,24H,14H2,1H3,(H2,28,30)/t22-,24-/m0/s1
Standard InChI Key: DCUQDDGCHPUQNI-UPVQGACJSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
9.0374 -6.4916 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2541 -7.2916 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.8385 -6.7040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9708 -7.7040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9708 -8.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6827 -8.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3947 -8.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3947 -7.7040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6827 -7.2874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6827 -6.4624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2568 -8.9426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3993 -6.0514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3997 -5.2271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6846 -4.8138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9678 -5.2308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9710 -6.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5425 -8.5299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8291 -8.9427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8298 -9.7687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5499 -10.1799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2604 -9.7647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4540 -7.5040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8726 -6.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0723 -7.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8533 -7.9224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4410 -8.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2390 -8.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1143 -4.8150 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.1104 -7.2937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8236 -7.7083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1128 -6.4687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0915 -6.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1165 -10.1831 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 1
5 11 1 1
10 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 10 1 0
11 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 11 1 0
4 2 1 0
2 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
13 28 1 0
8 29 1 0
29 30 1 0
29 31 2 0
23 32 1 0
19 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.44Molecular Weight (Monoisotopic): 500.0728AlogP: 5.59#Rotatable Bonds: 5Polar Surface Area: 80.47Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.59CX LogD: 5.59Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -0.78
References 1. (2013) Inhibitors of protein prenyltransferases,