(2S,6S)-2-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(o-tolylsulfonyl)-1,2,5,6-tetrahydropyridine-3-carboxamide

ID: ALA4537588

PubChem CID: 58360958

Max Phase: Preclinical

Molecular Formula: C25H22Cl2N2O3S

Molecular Weight: 501.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccccc1S(=O)(=O)N1[C@@H](c2cccc(Cl)c2)C(C(N)=O)=CC[C@H]1c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C25H22Cl2N2O3S/c1-16-5-2-3-8-23(16)33(31,32)29-22(17-9-11-19(26)12-10-17)14-13-21(25(28)30)24(29)18-6-4-7-20(27)15-18/h2-13,15,22,24H,14H2,1H3,(H2,28,30)/t22-,24-/m0/s1

Standard InChI Key:  DCUQDDGCHPUQNI-UPVQGACJSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    9.0374   -6.4916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2541   -7.2916    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.8385   -6.7040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9708   -7.7040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9708   -8.5290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6827   -8.9374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3947   -8.5290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3947   -7.7040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6827   -7.2874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6827   -6.4624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2568   -8.9426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3993   -6.0514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3997   -5.2271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6846   -4.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9678   -5.2308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9710   -6.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5425   -8.5299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8291   -8.9427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8298   -9.7687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5499  -10.1799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2604   -9.7647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4540   -7.5040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8726   -6.9129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0723   -7.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8533   -7.9224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4410   -8.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2390   -8.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1143   -4.8150    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   12.1104   -7.2937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8236   -7.7083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1128   -6.4687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0915   -6.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1165  -10.1831    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  1
  5 11  1  1
 10 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 10  1  0
 11 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 11  1  0
  4  2  1  0
  2 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 13 28  1  0
  8 29  1  0
 29 30  1  0
 29 31  2  0
 23 32  1  0
 19 33  1  0
M  END

Associated Targets(Human)

Jurkat (10389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 501.44Molecular Weight (Monoisotopic): 500.0728AlogP: 5.59#Rotatable Bonds: 5
Polar Surface Area: 80.47Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.59CX LogD: 5.59
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -0.78

References

1.  (2013)  Inhibitors of protein prenyltransferases, 

Source