4-(4-(1-(5-(4,5-Dimethyl-2-nitrophenyl)furan-2-yl)ethylidene)-3-methyl-5-oxo-4,5-dihydro-1H-pyrazol-1-yl)benzoic acid

ID: ALA4537592

PubChem CID: 155548318

Max Phase: Preclinical

Molecular Formula: C25H21N3O6

Molecular Weight: 459.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=NN(c2ccc(C(=O)O)cc2)C(=O)/C1=C(/C)c1ccc(-c2cc(C)c(C)cc2[N+](=O)[O-])o1

Standard InChI:  InChI=1S/C25H21N3O6/c1-13-11-19(20(28(32)33)12-14(13)2)22-10-9-21(34-22)15(3)23-16(4)26-27(24(23)29)18-7-5-17(6-8-18)25(30)31/h5-12H,1-4H3,(H,30,31)/b23-15-

Standard InChI Key:  DWPFUPITQDISNV-HAHDFKILSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   26.6605   -5.7781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6593   -6.6017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3715   -7.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0853   -6.6013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0825   -5.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3697   -5.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3641   -4.5507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0279   -4.0642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7731   -3.2836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9517   -3.2861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6975   -4.0682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.2514   -2.6211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0685   -2.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4799   -3.4161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2828   -3.2397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3658   -2.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6141   -2.0925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8909   -3.7886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7219   -4.5934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3341   -5.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1156   -4.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2815   -4.0748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6679   -3.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8100   -4.3185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.8347   -2.7254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.2202   -2.1779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6105   -2.4643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3713   -7.8320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6635   -8.2405    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0789   -8.2408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7264   -5.4263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1673   -5.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4704   -2.6256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9166   -1.8756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11  7  1  0
  6  7  1  0
  9 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 13  2  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 15 18  1  0
  8 24  2  0
 25 26  2  0
 25 27  1  0
 23 25  1  0
  3 28  1  0
 28 29  1  0
 28 30  2  0
 21 31  1  0
 20 32  1  0
 10 33  1  0
 12 34  1  0
M  CHG  2  25   1  27  -1
M  END

Alternative Forms

  1. Parent:

    ALA4537592

    ---

Associated Targets(Human)

EP300 Tchem Histone acetyltransferase p300 (1259 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.46Molecular Weight (Monoisotopic): 459.1430AlogP: 5.37#Rotatable Bonds: 5
Polar Surface Area: 126.25Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.98CX Basic pKa: CX LogP: 5.13CX LogD: 1.96
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: -1.05

References

1. Liu R, Zhang Z, Yang H, Zhou K, Geng M, Zhou W, Zhang M, Huang X, Li Y..  (2019)  Design, synthesis, and biological evaluation of a new class of histone acetyltransferase p300 inhibitors.,  180  [PMID:31306905] [10.1016/j.ejmech.2019.07.026]

Source