2-(2-fluoro-4-((5-fluorobenzo[d]thiazol-2-yl)oxy)phenyl)-N-(4-fluorphenethyl)acetamide

ID: ALA4537609

PubChem CID: 155548442

Max Phase: Preclinical

Molecular Formula: C23H17F3N2O2S

Molecular Weight: 442.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccc(Oc2nc3cc(F)ccc3s2)cc1F)NCCc1ccc(F)cc1

Standard InChI:  InChI=1S/C23H17F3N2O2S/c24-16-4-1-14(2-5-16)9-10-27-22(29)11-15-3-7-18(13-19(15)26)30-23-28-20-12-17(25)6-8-21(20)31-23/h1-8,12-13H,9-11H2,(H,27,29)

Standard InChI Key:  NXZPSJPTZRRXRZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   22.3089  -13.7580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0223  -14.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0220  -14.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7345  -15.3929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4458  -14.9816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4401  -14.1560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7270  -13.7498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1597  -15.3866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8695  -14.9744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5792  -15.3793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.8653  -14.1531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2890  -14.9671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0029  -15.3721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7126  -14.9599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4239  -15.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1331  -14.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1294  -14.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4105  -13.7234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7042  -14.1414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5986  -14.1734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8386  -13.7150    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.8491  -13.8405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.5187  -14.9872    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.7159  -15.1602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3068  -14.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4896  -14.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0805  -15.1652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4987  -15.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3145  -15.8686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7372  -16.2142    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.2591  -15.1695    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  5  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  1 20  1  0
 17 21  1  0
 20 22  2  0
 22 25  1  0
 24 23  1  0
 23 20  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  4 30  1  0
 27 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4537609

    ---

Associated Targets(Human)

EPHX2 Tchem Epoxide hydratase (3844 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
LTA4H Tchem Leukotriene A4 hydrolase (1442 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.46Molecular Weight (Monoisotopic): 442.0963AlogP: 5.41#Rotatable Bonds: 7
Polar Surface Area: 51.22Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.79CX LogD: 5.79
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: -1.72

References

1. Hiesinger K, Schott A, Kramer JS, Blöcher R, Witt F, Wittmann SK, Steinhilber D, Pogoryelov D, Gerstmeier J, Werz O, Proschak E..  (2020)  Design of Dual Inhibitors of Soluble Epoxide Hydrolase and LTA4 Hydrolase.,  11  (3): [PMID:32184960] [10.1021/acsmedchemlett.9b00330]

Source