The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-fluoro-4-((5-fluorobenzo[d]thiazol-2-yl)oxy)phenyl)-N-(4-fluorphenethyl)acetamide ID: ALA4537609
PubChem CID: 155548442
Max Phase: Preclinical
Molecular Formula: C23H17F3N2O2S
Molecular Weight: 442.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1ccc(Oc2nc3cc(F)ccc3s2)cc1F)NCCc1ccc(F)cc1
Standard InChI: InChI=1S/C23H17F3N2O2S/c24-16-4-1-14(2-5-16)9-10-27-22(29)11-15-3-7-18(13-19(15)26)30-23-28-20-12-17(25)6-8-21(20)31-23/h1-8,12-13H,9-11H2,(H,27,29)
Standard InChI Key: NXZPSJPTZRRXRZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
22.3089 -13.7580 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.0223 -14.1681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0220 -14.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7345 -15.3929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4458 -14.9816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4401 -14.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7270 -13.7498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1597 -15.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8695 -14.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5792 -15.3793 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8653 -14.1531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2890 -14.9671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0029 -15.3721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7126 -14.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4239 -15.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1331 -14.9545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1294 -14.1323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4105 -13.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7042 -14.1414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5986 -14.1734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8386 -13.7150 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.8491 -13.8405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5187 -14.9872 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.7159 -15.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3068 -14.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4896 -14.4541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0805 -15.1652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4987 -15.8749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3145 -15.8686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7372 -16.2142 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.2591 -15.1695 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
5 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
1 20 1 0
17 21 1 0
20 22 2 0
22 25 1 0
24 23 1 0
23 20 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
4 30 1 0
27 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.46Molecular Weight (Monoisotopic): 442.0963AlogP: 5.41#Rotatable Bonds: 7Polar Surface Area: 51.22Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.79CX LogD: 5.79Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: -1.72
References 1. Hiesinger K, Schott A, Kramer JS, Blöcher R, Witt F, Wittmann SK, Steinhilber D, Pogoryelov D, Gerstmeier J, Werz O, Proschak E.. (2020) Design of Dual Inhibitors of Soluble Epoxide Hydrolase and LTA4 Hydrolase., 11 (3): [PMID:32184960 ] [10.1021/acsmedchemlett.9b00330 ]