The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2-((4,4-Bis(4-fluorophenyl)-2-methylbutan-2-yl)amino)-1-hydroxyethyl)-8-hydroxyquinolin-2(1H)-one ID: ALA4537644
PubChem CID: 155548668
Max Phase: Preclinical
Molecular Formula: C28H28F2N2O3
Molecular Weight: 478.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(CC(c1ccc(F)cc1)c1ccc(F)cc1)NCC(O)c1ccc(O)c2[nH]c(=O)ccc12
Standard InChI: InChI=1S/C28H28F2N2O3/c1-28(2,15-23(17-3-7-19(29)8-4-17)18-5-9-20(30)10-6-18)31-16-25(34)21-11-13-24(33)27-22(21)12-14-26(35)32-27/h3-14,23,25,31,33-34H,15-16H2,1-2H3,(H,32,35)
Standard InChI Key: PBWAFYKWWMLLGW-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
17.6976 -17.2312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2931 -16.5254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8841 -17.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0489 -16.5419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0477 -17.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4626 -16.5383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7540 -16.1330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4654 -17.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7523 -17.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7478 -18.5838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4548 -18.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1680 -18.5933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1741 -17.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4492 -19.8170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3399 -17.7698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1688 -16.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8780 -16.5330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1657 -15.3098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5842 -16.1217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9996 -16.1164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7088 -16.5223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4150 -16.1110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1214 -16.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8271 -16.1085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8244 -15.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1102 -14.8847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4075 -15.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7119 -17.3395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0048 -17.7492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0075 -18.5656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7173 -18.9724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4258 -18.5567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4196 -17.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5301 -14.8783 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.7214 -19.7896 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 9 1 0
8 6 1 0
6 7 2 0
7 4 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
11 14 2 0
5 15 1 0
6 16 1 0
16 17 1 0
16 18 1 0
17 19 1 0
19 2 1 0
2 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
25 34 1 0
31 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.54Molecular Weight (Monoisotopic): 478.2068AlogP: 5.14#Rotatable Bonds: 8Polar Surface Area: 85.35Molecular Species: BASEHBA: 4HBD: 4#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.53CX Basic pKa: 9.96CX LogP: 4.01CX LogD: 3.03Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.28Np Likeness Score: -0.02
References 1. Xing G, Pan L, Yi C, Li X, Ge X, Zhao Y, Liu Y, Li J, Woo A, Lin B, Zhang Y, Cheng M.. (2019) Design, synthesis and biological evaluation of 5-(2-amino-1-hydroxyethyl)-8-hydroxyquinolin-2(1H)-one derivatives as potent β2 -adrenoceptor agonists., 27 (12): [PMID:30392952 ] [10.1016/j.bmc.2018.10.043 ]