5-(2-((4,4-Bis(4-fluorophenyl)-2-methylbutan-2-yl)amino)-1-hydroxyethyl)-8-hydroxyquinolin-2(1H)-one

ID: ALA4537644

PubChem CID: 155548668

Max Phase: Preclinical

Molecular Formula: C28H28F2N2O3

Molecular Weight: 478.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(CC(c1ccc(F)cc1)c1ccc(F)cc1)NCC(O)c1ccc(O)c2[nH]c(=O)ccc12

Standard InChI:  InChI=1S/C28H28F2N2O3/c1-28(2,15-23(17-3-7-19(29)8-4-17)18-5-9-20(30)10-6-18)31-16-25(34)21-11-13-24(33)27-22(21)12-14-26(35)32-27/h3-14,23,25,31,33-34H,15-16H2,1-2H3,(H,32,35)

Standard InChI Key:  PBWAFYKWWMLLGW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   17.6976  -17.2312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2931  -16.5254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8841  -17.2286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0489  -16.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0477  -17.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4626  -16.5383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7540  -16.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4654  -17.3610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7523  -17.7675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7478  -18.5838    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4548  -18.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1680  -18.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1741  -17.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4492  -19.8170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3399  -17.7698    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1688  -16.1270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8780  -16.5330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1657  -15.3098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5842  -16.1217    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9996  -16.1164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7088  -16.5223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4150  -16.1110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1214  -16.5191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8271  -16.1085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8244  -15.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1102  -14.8847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4075  -15.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7119  -17.3395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0048  -17.7492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0075  -18.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7173  -18.9724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4258  -18.5567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4196  -17.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5301  -14.8783    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.7214  -19.7896    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  9  1  0
  8  6  1  0
  6  7  2  0
  7  4  1  0
  8  9  2  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 11 14  2  0
  5 15  1  0
  6 16  1  0
 16 17  1  0
 16 18  1  0
 17 19  1  0
 19  2  1  0
  2 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 21 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 25 34  1  0
 31 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4537644

    ---

Associated Targets(Human)

ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 478.54Molecular Weight (Monoisotopic): 478.2068AlogP: 5.14#Rotatable Bonds: 8
Polar Surface Area: 85.35Molecular Species: BASEHBA: 4HBD: 4
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.53CX Basic pKa: 9.96CX LogP: 4.01CX LogD: 3.03
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.28Np Likeness Score: -0.02

References

1. Xing G, Pan L, Yi C, Li X, Ge X, Zhao Y, Liu Y, Li J, Woo A, Lin B, Zhang Y, Cheng M..  (2019)  Design, synthesis and biological evaluation of 5-(2-amino-1-hydroxyethyl)-8-hydroxyquinolin-2(1H)-one derivatives as potent β2-adrenoceptor agonists.,  27  (12): [PMID:30392952] [10.1016/j.bmc.2018.10.043]

Source