4-(4-(1-Cyclopentyl-1,2,3,4-tetrahydroisoquinolin-1-yl)[1,4'-bipiperidin]-1'-yl)benzonitrile

ID: ALA4537683

PubChem CID: 132104734

Max Phase: Preclinical

Molecular Formula: C31H40N4

Molecular Weight: 468.69

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#Cc1ccc(N2CCC(N3CCC(C4(C5CCCC5)NCCc5ccccc54)CC3)CC2)cc1

Standard InChI:  InChI=1S/C31H40N4/c32-23-24-9-11-28(12-10-24)35-21-16-29(17-22-35)34-19-14-27(15-20-34)31(26-6-2-3-7-26)30-8-4-1-5-25(30)13-18-33-31/h1,4-5,8-12,26-27,29,33H,2-3,6-7,13-22H2

Standard InChI Key:  CIOJAPDJRIHTLV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   24.9946  -11.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9934  -12.3341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7062  -12.7459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4207  -12.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7044  -11.0975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4169  -11.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1230  -11.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1228  -10.2748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4102   -9.8664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.6980  -10.2785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2786   -9.5605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6129   -8.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9921   -8.2459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2740   -8.6654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4512   -9.4778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8963  -10.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3156   -9.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5169  -10.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2924  -10.8983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.8730  -11.4905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6783  -11.2848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4906  -11.1061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9105  -10.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1117  -10.7185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8866  -11.5160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4667  -12.1085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2720  -11.9036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0894  -11.7193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5180  -11.1295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7215  -11.3323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4984  -12.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0780  -12.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8723  -12.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7036  -12.3310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9068  -12.5355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  1  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 10 16  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 25 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 34 35  3  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4537683

    ---

Associated Targets(Human)

MEN1 Tchem Menin (447 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.69Molecular Weight (Monoisotopic): 468.3253AlogP: 5.47#Rotatable Bonds: 4
Polar Surface Area: 42.30Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.15CX LogP: 5.49CX LogD: 1.11
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.65Np Likeness Score: -0.54

References

1. Aguilar A, Zheng K, Xu T, Xu S, Huang L, Fernandez-Salas E, Liu L, Bernard D, Harvey KP, Foster C, McEachern D, Stuckey J, Chinnaswamy K, Delproposto J, Kampf JW, Wang S..  (2019)  Structure-Based Discovery of M-89 as a Highly Potent Inhibitor of the Menin-Mixed Lineage Leukemia (Menin-MLL) Protein-Protein Interaction.,  62  (13): [PMID:31244110] [10.1021/acs.jmedchem.9b00021]

Source