The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-N-(4-Chlorophenyl)-6-(cyclopentyloxy)-7-methoxy-1-phenyl-3,4-dihydroisoquinoline-3-carboxamide ID: ALA4537714
PubChem CID: 155548321
Max Phase: Preclinical
Molecular Formula: C28H27ClN2O3
Molecular Weight: 474.99
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC1CCCC1)CC(C(=O)Nc1ccc(Cl)cc1)N=C2c1ccccc1
Standard InChI: InChI=1S/C28H27ClN2O3/c1-33-25-17-23-19(16-26(25)34-22-9-5-6-10-22)15-24(31-27(23)18-7-3-2-4-8-18)28(32)30-21-13-11-20(29)12-14-21/h2-4,7-8,11-14,16-17,22,24H,5-6,9-10,15H2,1H3,(H,30,32)
Standard InChI Key: FZYRRVJJFBUIHR-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
4.1853 -17.1511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1842 -17.9782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8987 -18.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8970 -16.7383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6123 -17.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6157 -17.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3347 -18.3916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0550 -17.9744 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0516 -17.1415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3279 -16.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3370 -19.2163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4708 -16.7387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4706 -15.9138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4695 -18.3901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7555 -17.9771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1438 -15.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8886 -14.6456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0638 -14.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8092 -15.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7647 -16.7268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4803 -17.1371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7620 -15.9019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1933 -16.7224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9085 -17.1346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6211 -16.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6190 -15.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8983 -15.4849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1887 -15.9012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3315 -15.4793 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.6237 -19.6308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6260 -20.4558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3416 -20.8663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0550 -20.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0527 -19.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
7 11 1 0
1 12 1 0
12 13 1 0
2 14 1 0
14 15 1 0
13 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 13 1 0
9 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
11 30 1 0
11 34 2 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.99Molecular Weight (Monoisotopic): 474.1710AlogP: 6.07#Rotatable Bonds: 6Polar Surface Area: 59.92Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.50CX Basic pKa: 2.84CX LogP: 6.48CX LogD: 6.48Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -0.33
References 1. Liao Y, Jia X, Tang Y, Li S, Zang Y, Wang L, Cui ZN, Song G.. (2019) Discovery of novel inhibitors of phosphodiesterase 4 with 1-phenyl-3,4-dihydroisoquinoline scaffold: Structure-based drug design and fragment identification., 29 (22): [PMID:31610942 ] [10.1016/j.bmcl.2019.126720 ]