2-O-p-Nitrobenzoyllycorine

ID: ALA4537731

PubChem CID: 155548414

Max Phase: Preclinical

Molecular Formula: C23H20N2O7

Molecular Weight: 436.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O[C@H]1C=C2CCN3Cc4cc5c(cc4[C@H]([C@@H]1O)[C@@H]23)OCO5)c1ccc([N+](=O)[O-])cc1

Standard InChI:  InChI=1S/C23H20N2O7/c26-22-19(32-23(27)12-1-3-15(4-2-12)25(28)29)7-13-5-6-24-10-14-8-17-18(31-11-30-17)9-16(14)20(22)21(13)24/h1-4,7-9,19-22,26H,5-6,10-11H2/t19-,20-,21+,22+/m0/s1

Standard InChI Key:  DZHIHVFPVHHNRF-FNAHDJPLSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    5.8854  -10.3139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1838  -10.7308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5912  -11.5397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5912  -10.7267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2928  -10.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1879  -11.5439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3011   -9.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8772   -9.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4822  -10.3346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8896  -11.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5912   -9.0923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4863  -11.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3671  -11.7874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8459  -11.1270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1838   -9.1005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8772  -11.1229    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5912   -9.9136    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7756  -11.5480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7847  -10.7308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0102  -10.4696    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5225  -11.1255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9956  -11.7919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5958   -8.2751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3057   -7.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3103   -7.0533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0112   -8.2830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0196   -6.6534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0245   -5.8370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3186   -5.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6062   -5.8326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6048   -6.6477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3219   -4.6058    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6160   -4.1942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0314   -4.2002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  1  0
  4  1  1  0
  5  4  1  0
  6  2  1  0
  7 11  1  0
  8  1  1  0
  9  2  2  0
 10  3  1  0
 11  8  1  0
 19  9  1  0
 12  6  2  0
 13  3  1  0
 14  5  1  0
  8 15  1  6
  1 16  1  1
  4 17  1  6
  5  7  2  0
 13 14  1  0
  6 10  1  0
 12 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 18  1  0
 11 23  1  1
 23 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 25  1  0
 32 33  2  0
 32 34  1  0
 29 32  1  0
M  CHG  2  32   1  34  -1
M  END

Alternative Forms

  1. Parent:

    ALA4537731

    ---

Associated Targets(non-human)

Trichomonas vaginalis (2376 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.42Molecular Weight (Monoisotopic): 436.1271AlogP: 2.52#Rotatable Bonds: 3
Polar Surface Area: 111.37Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.70CX Basic pKa: 8.07CX LogP: 2.60CX LogD: 1.84
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.34Np Likeness Score: 1.25

References

1. Nair JJ, van Staden J..  (2019)  Antiprotozoal alkaloid principles of the plant family Amaryllidaceae.,  29  (20): [PMID:31515186] [10.1016/j.bmcl.2019.126642]

Source