The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,6-dichloro-N'-(3,4,5-trimethoxybenzoyl)benzo[b]thiophene-2-carbohydrazide ID: ALA4537754
PubChem CID: 26586669
Max Phase: Preclinical
Molecular Formula: C19H16Cl2N2O5S
Molecular Weight: 455.32
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)NNC(=O)c2sc3cc(Cl)ccc3c2Cl)cc(OC)c1OC
Standard InChI: InChI=1S/C19H16Cl2N2O5S/c1-26-12-6-9(7-13(27-2)16(12)28-3)18(24)22-23-19(25)17-15(21)11-5-4-10(20)8-14(11)29-17/h4-8H,1-3H3,(H,22,24)(H,23,25)
Standard InChI Key: RUCVGOBRCRWBRC-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
20.7173 -3.4668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7161 -4.2864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4242 -4.6953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4224 -3.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1310 -3.4632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1313 -4.2819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9099 -4.5346 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.3909 -3.8721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9095 -3.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1617 -2.4328 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.0081 -4.6944 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
24.2081 -3.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6170 -4.5794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6165 -3.1640 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4337 -3.1637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8420 -2.4558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6592 -2.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4331 -1.7483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0630 -3.1627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8794 -3.1627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2886 -2.4543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8753 -1.7444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0603 -1.7479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2879 -3.8705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8792 -4.5781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1058 -2.4530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5156 -3.1600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2812 -1.0351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0984 -1.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
2 11 1 0
8 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 17 1 0
20 24 1 0
24 25 1 0
21 26 1 0
26 27 1 0
22 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.32Molecular Weight (Monoisotopic): 454.0157AlogP: 4.31#Rotatable Bonds: 5Polar Surface Area: 85.89Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.83CX Basic pKa: ┄CX LogP: 3.83CX LogD: 3.31Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.56Np Likeness Score: -1.36
References 1. Heng H, Zhi Y, Yuan H, Wang Z, Li H, Wang S, Tian J, Liu H, Chen Y, Lu T, Ran T, Lu S.. (2019) Discovery of a highly selective FLT3 inhibitor with specific proliferation inhibition against AML cells harboring FLT3-ITD mutation., 163 [PMID:30508668 ] [10.1016/j.ejmech.2018.11.063 ]